About bis(trimethylsilyl)azanide;pyrrolidin-1-ide;tin(2+)
bis(trimethylsilyl)azanide;pyrrolidin-1-ide;tin(2+) (PubChem CID 15966182) has the molecular formula C10H26N2Si2Sn
and a molecular weight of 349.22 g/mol. Its IUPAC name is bis(trimethylsilyl)azanide;pyrrolidin-1-ide;tin(2+).
Molecular Properties
| Compound Name | bis(trimethylsilyl)azanide;pyrrolidin-1-ide;tin(2+) |
| PubChem CID | 15966182 |
| Molecular Formula | C10H26N2Si2Sn |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | bis(trimethylsilyl)azanide;pyrrolidin-1-ide;tin(2+) |
| SMILES | C1CC[N-]C1.C[Si](C)(C)[N-][Si](C)(C)C.[Sn+2] |
| InChI | InChI=1S/C6H18NSi2.C4H8N.Sn/c1-8(2,3)7-9(4,5)6;1-2-4-5-3-1;/h1-6H3;1-4H2;/q2*-1;+2 |
| InChIKey | SLKPHKFEZUBPGM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 28.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(trimethylsilyl)azanide;pyrrolidin-1-ide;tin(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(trimethylsilyl)azanide;pyrrolidin-1-ide;tin(2+)?
The IUPAC name of bis(trimethylsilyl)azanide;pyrrolidin-1-ide;tin(2+) (CID 15966182) is bis(trimethylsilyl)azanide;pyrrolidin-1-ide;tin(2+).
What is the SMILES notation for bis(trimethylsilyl)azanide;pyrrolidin-1-ide;tin(2+)?
The canonical SMILES for bis(trimethylsilyl)azanide;pyrrolidin-1-ide;tin(2+) is C1CC[N-]C1.C[Si](C)(C)[N-][Si](C)(C)C.[Sn+2].
What is the InChIKey of bis(trimethylsilyl)azanide;pyrrolidin-1-ide;tin(2+)?
The InChIKey is SLKPHKFEZUBPGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H18NSi2.C4H8N.Sn/c1-8(2,3)7-9(4,5)6;1-2-4-5-3-1;/h1-6H3;1-4H2;/q2*-1;+2.
What are the key properties of bis(trimethylsilyl)azanide;pyrrolidin-1-ide;tin(2+)?
bis(trimethylsilyl)azanide;pyrrolidin-1-ide;tin(2+) has a molecular weight of 349.22 g/mol, XLogP of 3.80, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(trimethylsilyl)azanide;pyrrolidin-1-ide;tin(2+) is sourced from PubChem (CID 15966182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).