C37H58N2O8 — CID 159662085
4-[(1R)-2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenol;1-[(1R)-2-(dimethylamino)-1-(4-methoxyphenyl)ethyl]cyclohexan-1-ol;(E)-4-hydroperoxybut-2-enoic acid (PubChem CID 159662085) has the molecular formula C37H58N2O8 and a molecular weight of 658.88 g/mol. Its IUPAC name is 4-[(1R)-2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenol;1-[(1R)-2-(dimethylamino)-1-(4-methoxyphenyl)ethyl]cyclohexan-1-ol;(E)-4-hydroperoxybut-2-enoic acid.
| Compound Name | 4-[(1R)-2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenol;1-[(1R)-2-(dimethylamino)-1-(4-methoxyphenyl)ethyl]cyclohexan-1-ol;(E)-4-hydroperoxybut-2-enoic acid |
|---|---|
| PubChem CID | 159662085 |
| Molecular Formula | C37H58N2O8 |
| Molecular Weight | 658.88 g/mol |
| Exact Mass | 658.42 |
| IUPAC Name | 4-[(1R)-2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenol;1-[(1R)-2-(dimethylamino)-1-(4-methoxyphenyl)ethyl]cyclohexan-1-ol;(E)-4-hydroperoxybut-2-enoic acid |
| SMILES | CN(C)C[C@@H](c1ccc(O)cc1)C1(O)CCCCC1.COc1ccc([C@H](CN(C)C)C2(O)CCCCC2)cc1.O=C(O)/C=C/COO |
| InChI | InChI=1S/C17H27NO2.C16H25NO2.C4H6O4/c1-18(2)13-16(17(19)11-5-4-6-12-17)14-7-9-15(20-3)10-8-14;1-17(2)12-15(13-6-8-14(18)9-7-13)16(19)10-4-3-5-11-16;5-4(6)2-1-3-8-7/h7-10,16,19H,4-6,11-13H2,1-3H3;6-9,15,18-19H,3-5,10-12H2,1-2H3;1-2,7H,3H2,(H,5,6)/b;;2-1+/t16-;15-;/m00./s1 |
| InChIKey | MSYBWWHCOQXOIW-HQCOYGAFSA-N |
| XLogP | 5.89 |
| TPSA | 143.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.88 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|