About (1-isocyanato-2,2-dimethylpropyl)benzene
(1-isocyanato-2,2-dimethylpropyl)benzene (PubChem CID 15966262) has the molecular formula C12H15NO
and a molecular weight of 189.26 g/mol. Its IUPAC name is (1-isocyanato-2,2-dimethylpropyl)benzene.
Molecular Properties
| Compound Name | (1-isocyanato-2,2-dimethylpropyl)benzene |
| PubChem CID | 15966262 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | (1-isocyanato-2,2-dimethylpropyl)benzene |
| SMILES | CC(C)(C)C(N=C=O)c1ccccc1 |
| InChI | InChI=1S/C12H15NO/c1-12(2,3)11(13-9-14)10-7-5-4-6-8-10/h4-8,11H,1-3H3 |
| InChIKey | AEHGAXNXCNGCPP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze (1-isocyanato-2,2-dimethylpropyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-isocyanato-2,2-dimethylpropyl)benzene?
The IUPAC name of (1-isocyanato-2,2-dimethylpropyl)benzene (CID 15966262) is (1-isocyanato-2,2-dimethylpropyl)benzene.
What is the SMILES notation for (1-isocyanato-2,2-dimethylpropyl)benzene?
The canonical SMILES for (1-isocyanato-2,2-dimethylpropyl)benzene is CC(C)(C)C(N=C=O)c1ccccc1.
What is the InChIKey of (1-isocyanato-2,2-dimethylpropyl)benzene?
The InChIKey is AEHGAXNXCNGCPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO/c1-12(2,3)11(13-9-14)10-7-5-4-6-8-10/h4-8,11H,1-3H3.
What are the key properties of (1-isocyanato-2,2-dimethylpropyl)benzene?
(1-isocyanato-2,2-dimethylpropyl)benzene has a molecular weight of 189.26 g/mol, XLogP of 3.11, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-isocyanato-2,2-dimethylpropyl)benzene is sourced from PubChem (CID 15966262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).