About 4-O-tert-butyl 2-O-methyl 2-methylmorpholine-2,4-dicarboxylate;N-propan-2-ylpropan-2-amine
4-O-tert-butyl 2-O-methyl 2-methylmorpholine-2,4-dicarboxylate;N-propan-2-ylpropan-2-amine (PubChem CID 159662819) has the molecular formula C18H36N2O5
and a molecular weight of 360.50 g/mol. Its IUPAC name is 4-O-tert-butyl 2-O-methyl 2-methylmorpholine-2,4-dicarboxylate;N-propan-2-ylpropan-2-amine.
Molecular Properties
| Compound Name | 4-O-tert-butyl 2-O-methyl 2-methylmorpholine-2,4-dicarboxylate;N-propan-2-ylpropan-2-amine |
| PubChem CID | 159662819 |
| Molecular Formula | C18H36N2O5 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | 4-O-tert-butyl 2-O-methyl 2-methylmorpholine-2,4-dicarboxylate;N-propan-2-ylpropan-2-amine |
| SMILES | CC(C)NC(C)C.COC(=O)C1(C)CN(C(=O)OC(C)(C)C)CCO1 |
| InChI | InChI=1S/C12H21NO5.C6H15N/c1-11(2,3)18-10(15)13-6-7-17-12(4,8-13)9(14)16-5;1-5(2)7-6(3)4/h6-8H2,1-5H3;5-7H,1-4H3 |
| InChIKey | MTAJDDOIZYKDNJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-O-tert-butyl 2-O-methyl 2-methylmorpholine-2,4-dicarboxylate;N-propan-2-ylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-tert-butyl 2-O-methyl 2-methylmorpholine-2,4-dicarboxylate;N-propan-2-ylpropan-2-amine?
The IUPAC name of 4-O-tert-butyl 2-O-methyl 2-methylmorpholine-2,4-dicarboxylate;N-propan-2-ylpropan-2-amine (CID 159662819) is 4-O-tert-butyl 2-O-methyl 2-methylmorpholine-2,4-dicarboxylate;N-propan-2-ylpropan-2-amine.
What is the SMILES notation for 4-O-tert-butyl 2-O-methyl 2-methylmorpholine-2,4-dicarboxylate;N-propan-2-ylpropan-2-amine?
The canonical SMILES for 4-O-tert-butyl 2-O-methyl 2-methylmorpholine-2,4-dicarboxylate;N-propan-2-ylpropan-2-amine is CC(C)NC(C)C.COC(=O)C1(C)CN(C(=O)OC(C)(C)C)CCO1.
What is the InChIKey of 4-O-tert-butyl 2-O-methyl 2-methylmorpholine-2,4-dicarboxylate;N-propan-2-ylpropan-2-amine?
The InChIKey is MTAJDDOIZYKDNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO5.C6H15N/c1-11(2,3)18-10(15)13-6-7-17-12(4,8-13)9(14)16-5;1-5(2)7-6(3)4/h6-8H2,1-5H3;5-7H,1-4H3.
What are the key properties of 4-O-tert-butyl 2-O-methyl 2-methylmorpholine-2,4-dicarboxylate;N-propan-2-ylpropan-2-amine?
4-O-tert-butyl 2-O-methyl 2-methylmorpholine-2,4-dicarboxylate;N-propan-2-ylpropan-2-amine has a molecular weight of 360.50 g/mol, XLogP of 2.58, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-tert-butyl 2-O-methyl 2-methylmorpholine-2,4-dicarboxylate;N-propan-2-ylpropan-2-amine is sourced from PubChem (CID 159662819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).