C54H63F6N3O6 — CID 159663340
2-[4-(difluoromethoxy)phenyl]-5-heptoxypyridine;2-[4-(difluoromethoxy)phenyl]-5-hexoxypyridine;2-[4-(difluoromethoxy)phenyl]-5-pentoxypyridine (PubChem CID 159663340) has the molecular formula C54H63F6N3O6 and a molecular weight of 964.10 g/mol. Its IUPAC name is 2-[4-(difluoromethoxy)phenyl]-5-heptoxypyridine;2-[4-(difluoromethoxy)phenyl]-5-hexoxypyridine;2-[4-(difluoromethoxy)phenyl]-5-pentoxypyridine.
| Compound Name | 2-[4-(difluoromethoxy)phenyl]-5-heptoxypyridine;2-[4-(difluoromethoxy)phenyl]-5-hexoxypyridine;2-[4-(difluoromethoxy)phenyl]-5-pentoxypyridine |
|---|---|
| PubChem CID | 159663340 |
| Molecular Formula | C54H63F6N3O6 |
| Molecular Weight | 964.10 g/mol |
| Exact Mass | 963.46 |
| IUPAC Name | 2-[4-(difluoromethoxy)phenyl]-5-heptoxypyridine;2-[4-(difluoromethoxy)phenyl]-5-hexoxypyridine;2-[4-(difluoromethoxy)phenyl]-5-pentoxypyridine |
| SMILES | CCCCCCCOc1ccc(-c2ccc(OC(F)F)cc2)nc1.CCCCCCOc1ccc(-c2ccc(OC(F)F)cc2)nc1.CCCCCOc1ccc(-c2ccc(OC(F)F)cc2)nc1 |
| InChI | InChI=1S/C19H23F2NO2.C18H21F2NO2.C17H19F2NO2/c1-2-3-4-5-6-13-23-17-11-12-18(22-14-17)15-7-9-16(10-8-15)24-19(20)21;1-2-3-4-5-12-22-16-10-11-17(21-13-16)14-6-8-15(9-7-14)23-18(19)20;1-2-3-4-11-21-15-9-10-16(20-12-15)13-5-7-14(8-6-13)22-17(18)19/h7-12,14,19H,2-6,13H2,1H3;6-11,13,18H,2-5,12H2,1H3;5-10,12,17H,2-4,11H2,1H3 |
| InChIKey | MTCABSDWHMOZHO-UHFFFAOYSA-N |
| XLogP | 15.93 |
| TPSA | 94.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 964.10 |
| LogP ≤ 5 | 15.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|