C34H38F3N4O2S+ — CID 159663836
methane;5-[[1-phenyl-4-(3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidenemethyl)quinolin-1-ium-2-yl]amino]pentylazanium;2,2,2-trifluoroacetate (PubChem CID 159663836) has the molecular formula C34H38F3N4O2S+ and a molecular weight of 623.77 g/mol. Its IUPAC name is methane;5-[[1-phenyl-4-(3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidenemethyl)quinolin-1-ium-2-yl]amino]pentylazanium;2,2,2-trifluoroacetate.
| Compound Name | methane;5-[[1-phenyl-4-(3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidenemethyl)quinolin-1-ium-2-yl]amino]pentylazanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 159663836 |
| Molecular Formula | C34H38F3N4O2S+ |
| Molecular Weight | 623.77 g/mol |
| Exact Mass | 623.27 |
| IUPAC Name | methane;5-[[1-phenyl-4-(3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidenemethyl)quinolin-1-ium-2-yl]amino]pentylazanium;2,2,2-trifluoroacetate |
| SMILES | C.O=C([O-])C(F)(F)F.[NH3+]CCCCCNc1cc(C=C2Sc3cccc4c3N2CCC4)c2ccccc2[n+]1-c1ccccc1 |
| InChI | InChI=1S/C31H32N4S.C2HF3O2.CH4/c32-18-7-2-8-19-33-29-21-24(22-30-34-20-10-12-23-11-9-17-28(36-30)31(23)34)26-15-5-6-16-27(26)35(29)25-13-3-1-4-14-25;3-2(4,5)1(6)7;/h1,3-6,9,11,13-17,21-22H,2,7-8,10,12,18-20,32H2;(H,6,7);1H4/p+1 |
| InChIKey | GKMMNKWAMSONHO-UHFFFAOYSA-O |
| XLogP | 5.73 |
| TPSA | 86.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.77 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|