C18H19N3O — CID 159664615
5-(4-methoxyphenyl)-2-(2-methylidenebutyl)-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 159664615) has the molecular formula C18H19N3O and a molecular weight of 293.37 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-2-(2-methylidenebutyl)-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 5-(4-methoxyphenyl)-2-(2-methylidenebutyl)-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 159664615 |
| Molecular Formula | C18H19N3O |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 5-(4-methoxyphenyl)-2-(2-methylidenebutyl)-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | C=C(CC)Cc1nc2cccc(-c3ccc(OC)cc3)n2n1 |
| InChI | InChI=1S/C18H19N3O/c1-4-13(2)12-17-19-18-7-5-6-16(21(18)20-17)14-8-10-15(22-3)11-9-14/h5-11H,2,4,12H2,1,3H3 |
| InChIKey | BTFZPZQGDYKEFI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|