About 2,3-dihydrothiophene;2-phenylprop-2-enenitrile
2,3-dihydrothiophene;2-phenylprop-2-enenitrile (PubChem CID 159664982) has the molecular formula C13H13NS
and a molecular weight of 215.32 g/mol. Its IUPAC name is 2,3-dihydrothiophene;2-phenylprop-2-enenitrile.
Molecular Properties
| Compound Name | 2,3-dihydrothiophene;2-phenylprop-2-enenitrile |
| PubChem CID | 159664982 |
| Molecular Formula | C13H13NS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 2,3-dihydrothiophene;2-phenylprop-2-enenitrile |
| SMILES | C1=CSCC1.C=C(C#N)c1ccccc1 |
| InChI | InChI=1S/C9H7N.C4H6S/c1-8(7-10)9-5-3-2-4-6-9;1-2-4-5-3-1/h2-6H,1H2;1,3H,2,4H2 |
| InChIKey | MTHDVLMNGGCPEO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydrothiophene;2-phenylprop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydrothiophene;2-phenylprop-2-enenitrile?
The IUPAC name of 2,3-dihydrothiophene;2-phenylprop-2-enenitrile (CID 159664982) is 2,3-dihydrothiophene;2-phenylprop-2-enenitrile.
What is the SMILES notation for 2,3-dihydrothiophene;2-phenylprop-2-enenitrile?
The canonical SMILES for 2,3-dihydrothiophene;2-phenylprop-2-enenitrile is C1=CSCC1.C=C(C#N)c1ccccc1.
What is the InChIKey of 2,3-dihydrothiophene;2-phenylprop-2-enenitrile?
The InChIKey is MTHDVLMNGGCPEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C4H6S/c1-8(7-10)9-5-3-2-4-6-9;1-2-4-5-3-1/h2-6H,1H2;1,3H,2,4H2.
What are the key properties of 2,3-dihydrothiophene;2-phenylprop-2-enenitrile?
2,3-dihydrothiophene;2-phenylprop-2-enenitrile has a molecular weight of 215.32 g/mol, XLogP of 3.86, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydrothiophene;2-phenylprop-2-enenitrile is sourced from PubChem (CID 159664982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).