C31H31N3O2 — CID 159665413
(3Z,8R,9R,10S)-10-(hydroxymethyl)-N-(4-methylphenyl)-9-[4-(2-phenylethynyl)phenyl]-1,6-diazabicyclo[6.2.0]dec-3-ene-6-carboxamide (PubChem CID 159665413) has the molecular formula C31H31N3O2 and a molecular weight of 477.61 g/mol. Its IUPAC name is (3Z,8R,9R,10S)-10-(hydroxymethyl)-N-(4-methylphenyl)-9-[4-(2-phenylethynyl)phenyl]-1,6-diazabicyclo[6.2.0]dec-3-ene-6-carboxamide.
| Compound Name | (3Z,8R,9R,10S)-10-(hydroxymethyl)-N-(4-methylphenyl)-9-[4-(2-phenylethynyl)phenyl]-1,6-diazabicyclo[6.2.0]dec-3-ene-6-carboxamide |
|---|---|
| PubChem CID | 159665413 |
| Molecular Formula | C31H31N3O2 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | (3Z,8R,9R,10S)-10-(hydroxymethyl)-N-(4-methylphenyl)-9-[4-(2-phenylethynyl)phenyl]-1,6-diazabicyclo[6.2.0]dec-3-ene-6-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2C/C=C\CN3[C@H](CO)[C@H](c4ccc(C#Cc5ccccc5)cc4)[C@@H]3C2)cc1 |
| InChI | InChI=1S/C31H31N3O2/c1-23-9-17-27(18-10-23)32-31(36)33-19-5-6-20-34-28(21-33)30(29(34)22-35)26-15-13-25(14-16-26)12-11-24-7-3-2-4-8-24/h2-10,13-18,28-30,35H,19-22H2,1H3,(H,32,36)/b6-5-/t28-,29+,30+/m0/s1 |
| InChIKey | XUSBELQZMGWHCU-CGARMGMVSA-N |
| XLogP | 4.63 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|