About N-[(5E)-1-iminohepta-1,3,5-trien-2-yl]-N-methylaniline
N-[(5E)-1-iminohepta-1,3,5-trien-2-yl]-N-methylaniline (PubChem CID 15966558) has the molecular formula C14H16N2
and a molecular weight of 212.30 g/mol. Its IUPAC name is N-[(5E)-1-iminohepta-1,3,5-trien-2-yl]-N-methylaniline.
Molecular Properties
| Compound Name | N-[(5E)-1-iminohepta-1,3,5-trien-2-yl]-N-methylaniline |
| PubChem CID | 15966558 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | N-[(5E)-1-iminohepta-1,3,5-trien-2-yl]-N-methylaniline |
| SMILES | C/C=C/C=CC(=C=N)N(C)c1ccccc1 |
| InChI | InChI=1S/C14H16N2/c1-3-4-6-11-14(12-15)16(2)13-9-7-5-8-10-13/h3-11,15H,1-2H3/b4-3+,11-6? |
| InChIKey | ISDRQMHZHZQJGM-GAUFXNGNSA-N |
| XLogP | 3.39 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(5E)-1-iminohepta-1,3,5-trien-2-yl]-N-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5E)-1-iminohepta-1,3,5-trien-2-yl]-N-methylaniline?
The IUPAC name of N-[(5E)-1-iminohepta-1,3,5-trien-2-yl]-N-methylaniline (CID 15966558) is N-[(5E)-1-iminohepta-1,3,5-trien-2-yl]-N-methylaniline.
What is the SMILES notation for N-[(5E)-1-iminohepta-1,3,5-trien-2-yl]-N-methylaniline?
The canonical SMILES for N-[(5E)-1-iminohepta-1,3,5-trien-2-yl]-N-methylaniline is C/C=C/C=CC(=C=N)N(C)c1ccccc1.
What is the InChIKey of N-[(5E)-1-iminohepta-1,3,5-trien-2-yl]-N-methylaniline?
The InChIKey is ISDRQMHZHZQJGM-GAUFXNGNSA-N. The full InChI is InChI=1S/C14H16N2/c1-3-4-6-11-14(12-15)16(2)13-9-7-5-8-10-13/h3-11,15H,1-2H3/b4-3+,11-6?.
What are the key properties of N-[(5E)-1-iminohepta-1,3,5-trien-2-yl]-N-methylaniline?
N-[(5E)-1-iminohepta-1,3,5-trien-2-yl]-N-methylaniline has a molecular weight of 212.30 g/mol, XLogP of 3.39, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5E)-1-iminohepta-1,3,5-trien-2-yl]-N-methylaniline is sourced from PubChem (CID 15966558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).