About bis(bicyclo[2.2.1]hepta-1,3-diene);nickel
bis(bicyclo[2.2.1]hepta-1,3-diene);nickel (PubChem CID 159665742) has the molecular formula C14H16Ni
and a molecular weight of 242.97 g/mol. Its IUPAC name is bis(bicyclo[2.2.1]hepta-1,3-diene);nickel.
Molecular Properties
| Compound Name | bis(bicyclo[2.2.1]hepta-1,3-diene);nickel |
| PubChem CID | 159665742 |
| Molecular Formula | C14H16Ni |
| Molecular Weight | 242.97 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | bis(bicyclo[2.2.1]hepta-1,3-diene);nickel |
| SMILES | C1=C2CCC(=C1)C2.C1=C2CCC(=C1)C2.[Ni] |
| InChI | InChI=1S/2C7H8.Ni/c2*1-2-7-4-3-6(1)5-7;/h2*1-2H,3-5H2; |
| InChIKey | MTJKWBDSHIJKMK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.97 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze bis(bicyclo[2.2.1]hepta-1,3-diene);nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(bicyclo[2.2.1]hepta-1,3-diene);nickel?
The IUPAC name of bis(bicyclo[2.2.1]hepta-1,3-diene);nickel (CID 159665742) is bis(bicyclo[2.2.1]hepta-1,3-diene);nickel.
What is the SMILES notation for bis(bicyclo[2.2.1]hepta-1,3-diene);nickel?
The canonical SMILES for bis(bicyclo[2.2.1]hepta-1,3-diene);nickel is C1=C2CCC(=C1)C2.C1=C2CCC(=C1)C2.[Ni].
What is the InChIKey of bis(bicyclo[2.2.1]hepta-1,3-diene);nickel?
The InChIKey is MTJKWBDSHIJKMK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H8.Ni/c2*1-2-7-4-3-6(1)5-7;/h2*1-2H,3-5H2;.
What are the key properties of bis(bicyclo[2.2.1]hepta-1,3-diene);nickel?
bis(bicyclo[2.2.1]hepta-1,3-diene);nickel has a molecular weight of 242.97 g/mol, XLogP of 4.07, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(bicyclo[2.2.1]hepta-1,3-diene);nickel is sourced from PubChem (CID 159665742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).