C41H46N8O4 — CID 159666261
5-[6-(1-ethoxyethyl)-4-ethyl-9H-pyrido[3,4-b]indol-3-yl]-3-ethyl-1,2,4-oxadiazole;5-[6-(1-ethoxyethyl)-4-methyl-9H-pyrido[3,4-b]indol-3-yl]-3-ethyl-1,2,4-oxadiazole (PubChem CID 159666261) has the molecular formula C41H46N8O4 and a molecular weight of 714.87 g/mol. Its IUPAC name is 5-[6-(1-ethoxyethyl)-4-ethyl-9H-pyrido[3,4-b]indol-3-yl]-3-ethyl-1,2,4-oxadiazole;5-[6-(1-ethoxyethyl)-4-methyl-9H-pyrido[3,4-b]indol-3-yl]-3-ethyl-1,2,4-oxadiazole.
| Compound Name | 5-[6-(1-ethoxyethyl)-4-ethyl-9H-pyrido[3,4-b]indol-3-yl]-3-ethyl-1,2,4-oxadiazole;5-[6-(1-ethoxyethyl)-4-methyl-9H-pyrido[3,4-b]indol-3-yl]-3-ethyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 159666261 |
| Molecular Formula | C41H46N8O4 |
| Molecular Weight | 714.87 g/mol |
| Exact Mass | 714.36 |
| IUPAC Name | 5-[6-(1-ethoxyethyl)-4-ethyl-9H-pyrido[3,4-b]indol-3-yl]-3-ethyl-1,2,4-oxadiazole;5-[6-(1-ethoxyethyl)-4-methyl-9H-pyrido[3,4-b]indol-3-yl]-3-ethyl-1,2,4-oxadiazole |
| SMILES | CCOC(C)c1ccc2[nH]c3cnc(-c4nc(CC)no4)c(C)c3c2c1.CCOC(C)c1ccc2[nH]c3cnc(-c4nc(CC)no4)c(CC)c3c2c1 |
| InChI | InChI=1S/C21H24N4O2.C20H22N4O2/c1-5-14-19-15-10-13(12(4)26-7-3)8-9-16(15)23-17(19)11-22-20(14)21-24-18(6-2)25-27-21;1-5-17-23-20(26-24-17)19-11(3)18-14-9-13(12(4)25-6-2)7-8-15(14)22-16(18)10-21-19/h8-12,23H,5-7H2,1-4H3;7-10,12,22H,5-6H2,1-4H3 |
| InChIKey | MTLAULFBYZQMBI-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 153.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.87 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |