C14H12F10N4O2S — CID 159666447
5-[5-amino-3-(trifluoromethyl)-1,2,4-triazol-1-yl]-4-fluoro-2-methylphenol;1,1,1-trifluoro-2-(2,2,2-trifluoroethylsulfinyl)ethane (PubChem CID 159666447) has the molecular formula C14H12F10N4O2S and a molecular weight of 490.32 g/mol. Its IUPAC name is 5-[5-amino-3-(trifluoromethyl)-1,2,4-triazol-1-yl]-4-fluoro-2-methylphenol;1,1,1-trifluoro-2-(2,2,2-trifluoroethylsulfinyl)ethane.
| Compound Name | 5-[5-amino-3-(trifluoromethyl)-1,2,4-triazol-1-yl]-4-fluoro-2-methylphenol;1,1,1-trifluoro-2-(2,2,2-trifluoroethylsulfinyl)ethane |
|---|---|
| PubChem CID | 159666447 |
| Molecular Formula | C14H12F10N4O2S |
| Molecular Weight | 490.32 g/mol |
| Exact Mass | 490.05 |
| IUPAC Name | 5-[5-amino-3-(trifluoromethyl)-1,2,4-triazol-1-yl]-4-fluoro-2-methylphenol;1,1,1-trifluoro-2-(2,2,2-trifluoroethylsulfinyl)ethane |
| SMILES | Cc1cc(F)c(-n2nc(C(F)(F)F)nc2N)cc1O.O=S(CC(F)(F)F)CC(F)(F)F |
| InChI | InChI=1S/C10H8F4N4O.C4H4F6OS/c1-4-2-5(11)6(3-7(4)19)18-9(15)16-8(17-18)10(12,13)14;5-3(6,7)1-12(11)2-4(8,9)10/h2-3,19H,1H3,(H2,15,16,17);1-2H2 |
| InChIKey | MTLRPADUXJEKTP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.32 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |