C19H36O12S4 — CID 159668748
1,1-dioxothiane-4-carboxylic acid;(1,1-dioxothian-4-yl)methanol;(1,1-dioxothian-4-yl)methyl methanesulfonate (PubChem CID 159668748) has the molecular formula C19H36O12S4 and a molecular weight of 584.75 g/mol. Its IUPAC name is 1,1-dioxothiane-4-carboxylic acid;(1,1-dioxothian-4-yl)methanol;(1,1-dioxothian-4-yl)methyl methanesulfonate.
| Compound Name | 1,1-dioxothiane-4-carboxylic acid;(1,1-dioxothian-4-yl)methanol;(1,1-dioxothian-4-yl)methyl methanesulfonate |
|---|---|
| PubChem CID | 159668748 |
| Molecular Formula | C19H36O12S4 |
| Molecular Weight | 584.75 g/mol |
| Exact Mass | 584.11 |
| IUPAC Name | 1,1-dioxothiane-4-carboxylic acid;(1,1-dioxothian-4-yl)methanol;(1,1-dioxothian-4-yl)methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCC1CCS(=O)(=O)CC1.O=C(O)C1CCS(=O)(=O)CC1.O=S1(=O)CCC(CO)CC1 |
| InChI | InChI=1S/C7H14O5S2.C6H10O4S.C6H12O3S/c1-13(8,9)12-6-7-2-4-14(10,11)5-3-7;7-6(8)5-1-3-11(9,10)4-2-5;7-5-6-1-3-10(8,9)4-2-6/h7H,2-6H2,1H3;5H,1-4H2,(H,7,8);6-7H,1-5H2 |
| InChIKey | MTTBGZCSLLFNNC-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 203.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.75 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|