About 2-bromopyridine;[4-chloro-3-(hydroxymethyl)phenyl]boronic acid
2-bromopyridine;[4-chloro-3-(hydroxymethyl)phenyl]boronic acid (PubChem CID 159669147) has the molecular formula C12H12BBrClNO3
and a molecular weight of 344.40 g/mol. Its IUPAC name is 2-bromopyridine;[4-chloro-3-(hydroxymethyl)phenyl]boronic acid.
Molecular Properties
| Compound Name | 2-bromopyridine;[4-chloro-3-(hydroxymethyl)phenyl]boronic acid |
| PubChem CID | 159669147 |
| Molecular Formula | C12H12BBrClNO3 |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 342.98 |
| IUPAC Name | 2-bromopyridine;[4-chloro-3-(hydroxymethyl)phenyl]boronic acid |
| SMILES | Brc1ccccn1.OCc1cc(B(O)O)ccc1Cl |
| InChI | InChI=1S/C7H8BClO3.C5H4BrN/c9-7-2-1-6(8(11)12)3-5(7)4-10;6-5-3-1-2-4-7-5/h1-3,10-12H,4H2;1-4H |
| InChIKey | MTUFBCGYXGTWRM-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-bromopyridine;[4-chloro-3-(hydroxymethyl)phenyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromopyridine;[4-chloro-3-(hydroxymethyl)phenyl]boronic acid?
The IUPAC name of 2-bromopyridine;[4-chloro-3-(hydroxymethyl)phenyl]boronic acid (CID 159669147) is 2-bromopyridine;[4-chloro-3-(hydroxymethyl)phenyl]boronic acid.
What is the SMILES notation for 2-bromopyridine;[4-chloro-3-(hydroxymethyl)phenyl]boronic acid?
The canonical SMILES for 2-bromopyridine;[4-chloro-3-(hydroxymethyl)phenyl]boronic acid is Brc1ccccn1.OCc1cc(B(O)O)ccc1Cl.
What is the InChIKey of 2-bromopyridine;[4-chloro-3-(hydroxymethyl)phenyl]boronic acid?
The InChIKey is MTUFBCGYXGTWRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8BClO3.C5H4BrN/c9-7-2-1-6(8(11)12)3-5(7)4-10;6-5-3-1-2-4-7-5/h1-3,10-12H,4H2;1-4H.
What are the key properties of 2-bromopyridine;[4-chloro-3-(hydroxymethyl)phenyl]boronic acid?
2-bromopyridine;[4-chloro-3-(hydroxymethyl)phenyl]boronic acid has a molecular weight of 344.40 g/mol, XLogP of 1.36, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromopyridine;[4-chloro-3-(hydroxymethyl)phenyl]boronic acid is sourced from PubChem (CID 159669147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).