C37H47N3O3S — CID 159669530
(3R,6R)-1-[(1R)-1-[4-(4-tert-butyl-1,3-thiazol-2-yl)phenyl]-4,4-dimethyl-2-oxopentyl]-3-(2,3-dihydro-1H-inden-2-yl)-6-(2-methylpropyl)piperazine-2,5-dione (PubChem CID 159669530) has the molecular formula C37H47N3O3S and a molecular weight of 613.87 g/mol. Its IUPAC name is (3R,6R)-1-[(1R)-1-[4-(4-tert-butyl-1,3-thiazol-2-yl)phenyl]-4,4-dimethyl-2-oxopentyl]-3-(2,3-dihydro-1H-inden-2-yl)-6-(2-methylpropyl)piperazine-2,5-dione.
| Compound Name | (3R,6R)-1-[(1R)-1-[4-(4-tert-butyl-1,3-thiazol-2-yl)phenyl]-4,4-dimethyl-2-oxopentyl]-3-(2,3-dihydro-1H-inden-2-yl)-6-(2-methylpropyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 159669530 |
| Molecular Formula | C37H47N3O3S |
| Molecular Weight | 613.87 g/mol |
| Exact Mass | 613.33 |
| IUPAC Name | (3R,6R)-1-[(1R)-1-[4-(4-tert-butyl-1,3-thiazol-2-yl)phenyl]-4,4-dimethyl-2-oxopentyl]-3-(2,3-dihydro-1H-inden-2-yl)-6-(2-methylpropyl)piperazine-2,5-dione |
| SMILES | CC(C)C[C@@H]1C(=O)N[C@H](C2Cc3ccccc3C2)C(=O)N1[C@@H](C(=O)CC(C)(C)C)c1ccc(-c2nc(C(C)(C)C)cs2)cc1 |
| InChI | InChI=1S/C37H47N3O3S/c1-22(2)17-28-33(42)39-31(27-18-25-11-9-10-12-26(25)19-27)35(43)40(28)32(29(41)20-36(3,4)5)23-13-15-24(16-14-23)34-38-30(21-44-34)37(6,7)8/h9-16,21-22,27-28,31-32H,17-20H2,1-8H3,(H,39,42)/t28-,31-,32-/m1/s1 |
| InChIKey | MTVAVCREJVSWFG-DOTMXCTOSA-N |
| XLogP | 7.31 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.87 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |