About 2,2-difluoroethanimidamide fluoride
2,2-difluoroethanimidamide fluoride (PubChem CID 159669726) has the molecular formula C2H4F3N2-
and a molecular weight of 113.06 g/mol. Its IUPAC name is 2,2-difluoroethanimidamide fluoride.
Molecular Properties
| Compound Name | 2,2-difluoroethanimidamide fluoride |
| PubChem CID | 159669726 |
| Molecular Formula | C2H4F3N2- |
| Molecular Weight | 113.06 g/mol |
| Exact Mass | 113.03 |
| IUPAC Name | 2,2-difluoroethanimidamide fluoride |
| SMILES | [F-].[H]/N=C(\N)C(F)F |
| InChI | InChI=1S/C2H4F2N2.FH/c3-1(4)2(5)6;/h1H,(H3,5,6);1H/p-1 |
| InChIKey | MTVRFBGZFGJSKQ-UHFFFAOYSA-M |
| XLogP | -2.81 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.06 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2,2-difluoroethanimidamide fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoroethanimidamide fluoride?
The IUPAC name of 2,2-difluoroethanimidamide fluoride (CID 159669726) is 2,2-difluoroethanimidamide fluoride.
What is the SMILES notation for 2,2-difluoroethanimidamide fluoride?
The canonical SMILES for 2,2-difluoroethanimidamide fluoride is [F-].[H]/N=C(\N)C(F)F.
What is the InChIKey of 2,2-difluoroethanimidamide fluoride?
The InChIKey is MTVRFBGZFGJSKQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4F2N2.FH/c3-1(4)2(5)6;/h1H,(H3,5,6);1H/p-1.
What are the key properties of 2,2-difluoroethanimidamide fluoride?
2,2-difluoroethanimidamide fluoride has a molecular weight of 113.06 g/mol, XLogP of -2.81, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoroethanimidamide fluoride is sourced from PubChem (CID 159669726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).