C22H30Cl2N4O5 — CID 159670237
3-(2-chloroethyl)-9-hydroxy-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one;3-(2-chloroethyl)-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one;molecular oxygen (PubChem CID 159670237) has the molecular formula C22H30Cl2N4O5 and a molecular weight of 501.41 g/mol. Its IUPAC name is 3-(2-chloroethyl)-9-hydroxy-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one;3-(2-chloroethyl)-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one;molecular oxygen.
| Compound Name | 3-(2-chloroethyl)-9-hydroxy-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one;3-(2-chloroethyl)-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one;molecular oxygen |
|---|---|
| PubChem CID | 159670237 |
| Molecular Formula | C22H30Cl2N4O5 |
| Molecular Weight | 501.41 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | 3-(2-chloroethyl)-9-hydroxy-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one;3-(2-chloroethyl)-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one;molecular oxygen |
| SMILES | Cc1nc2n(c(=O)c1CCCl)CCCC2.Cc1nc2n(c(=O)c1CCCl)CCCC2O.O=O |
| InChI | InChI=1S/C11H15ClN2O2.C11H15ClN2O.O2/c1-7-8(4-5-12)11(16)14-6-2-3-9(15)10(14)13-7;1-8-9(5-6-12)11(15)14-7-3-2-4-10(14)13-8;1-2/h9,15H,2-6H2,1H3;2-7H2,1H3; |
| InChIKey | MTXGEBDHOFJNPR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|