C23H34O6S2 — CID 15967082
(1R,2R,6S,8S,10S,11R,12S)-11-hydroxy-8-methyl-12-(2-methylpropylsulfanyl)-3-(2-methylpropylsulfanylmethyl)-5,9,15-trioxatetracyclo[11.2.1.02,6.08,10]hexadec-13(16)-ene-4,14-dione (PubChem CID 15967082) has the molecular formula C23H34O6S2 and a molecular weight of 470.65 g/mol. Its IUPAC name is (1R,2R,6S,8S,10S,11R,12S)-11-hydroxy-8-methyl-12-(2-methylpropylsulfanyl)-3-(2-methylpropylsulfanylmethyl)-5,9,15-trioxatetracyclo[11.2.1.02,6.08,10]hexadec-13(16)-ene-4,14-dione.
| Compound Name | (1R,2R,6S,8S,10S,11R,12S)-11-hydroxy-8-methyl-12-(2-methylpropylsulfanyl)-3-(2-methylpropylsulfanylmethyl)-5,9,15-trioxatetracyclo[11.2.1.02,6.08,10]hexadec-13(16)-ene-4,14-dione |
|---|---|
| PubChem CID | 15967082 |
| Molecular Formula | C23H34O6S2 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | (1R,2R,6S,8S,10S,11R,12S)-11-hydroxy-8-methyl-12-(2-methylpropylsulfanyl)-3-(2-methylpropylsulfanylmethyl)-5,9,15-trioxatetracyclo[11.2.1.02,6.08,10]hexadec-13(16)-ene-4,14-dione |
| SMILES | CC(C)CSCC1C(=O)O[C@H]2C[C@]3(C)O[C@H]3[C@@H](O)[C@@H](SCC(C)C)C3=C[C@@H](OC3=O)[C@H]12 |
| InChI | InChI=1S/C23H34O6S2/c1-11(2)8-30-10-14-17-15-6-13(21(25)27-15)19(31-9-12(3)4)18(24)20-23(5,29-20)7-16(17)28-22(14)26/h6,11-12,14-20,24H,7-10H2,1-5H3/t14?,15-,16+,17+,18+,19+,20+,23+/m1/s1 |
| InChIKey | FTMFLMCIVANCIV-UWOBUVKHSA-N |
| XLogP | 3.07 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|