C26H35FN2O4 — CID 159671184
3-[(2,6-dimethylmorpholin-4-yl)methyl]-6-fluoro-9-(7-hydroxy-6-oxoheptyl)-2,3-dihydro-1H-carbazol-4-one (PubChem CID 159671184) has the molecular formula C26H35FN2O4 and a molecular weight of 458.57 g/mol. Its IUPAC name is 3-[(2,6-dimethylmorpholin-4-yl)methyl]-6-fluoro-9-(7-hydroxy-6-oxoheptyl)-2,3-dihydro-1H-carbazol-4-one.
| Compound Name | 3-[(2,6-dimethylmorpholin-4-yl)methyl]-6-fluoro-9-(7-hydroxy-6-oxoheptyl)-2,3-dihydro-1H-carbazol-4-one |
|---|---|
| PubChem CID | 159671184 |
| Molecular Formula | C26H35FN2O4 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | 3-[(2,6-dimethylmorpholin-4-yl)methyl]-6-fluoro-9-(7-hydroxy-6-oxoheptyl)-2,3-dihydro-1H-carbazol-4-one |
| SMILES | CC1CN(CC2CCc3c(c4cc(F)ccc4n3CCCCCC(=O)CO)C2=O)CC(C)O1 |
| InChI | InChI=1S/C26H35FN2O4/c1-17-13-28(14-18(2)33-17)15-19-7-9-24-25(26(19)32)22-12-20(27)8-10-23(22)29(24)11-5-3-4-6-21(31)16-30/h8,10,12,17-19,30H,3-7,9,11,13-16H2,1-2H3 |
| InChIKey | MUABVSRQOSEMBX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|