About 5-tert-butyl-1-methylimidazole;2-tert-butyl-1,3-oxazole;5-tert-butyl-1,3-oxazole
5-tert-butyl-1-methylimidazole;2-tert-butyl-1,3-oxazole;5-tert-butyl-1,3-oxazole (PubChem CID 159672654) has the molecular formula C22H36N4O2
and a molecular weight of 388.56 g/mol. Its IUPAC name is 5-tert-butyl-1-methylimidazole;2-tert-butyl-1,3-oxazole;5-tert-butyl-1,3-oxazole.
Molecular Properties
| Compound Name | 5-tert-butyl-1-methylimidazole;2-tert-butyl-1,3-oxazole;5-tert-butyl-1,3-oxazole |
| PubChem CID | 159672654 |
| Molecular Formula | C22H36N4O2 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | 5-tert-butyl-1-methylimidazole;2-tert-butyl-1,3-oxazole;5-tert-butyl-1,3-oxazole |
| SMILES | CC(C)(C)c1cnco1.CC(C)(C)c1ncco1.Cn1cncc1C(C)(C)C |
| InChI | InChI=1S/C8H14N2.2C7H11NO/c1-8(2,3)7-5-9-6-10(7)4;1-7(2,3)6-4-8-5-9-6;1-7(2,3)6-8-4-5-9-6/h5-6H,1-4H3;2*4-5H,1-3H3 |
| InChIKey | MUEROQRGUREWRM-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 69.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-tert-butyl-1-methylimidazole;2-tert-butyl-1,3-oxazole;5-tert-butyl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-1-methylimidazole;2-tert-butyl-1,3-oxazole;5-tert-butyl-1,3-oxazole?
The IUPAC name of 5-tert-butyl-1-methylimidazole;2-tert-butyl-1,3-oxazole;5-tert-butyl-1,3-oxazole (CID 159672654) is 5-tert-butyl-1-methylimidazole;2-tert-butyl-1,3-oxazole;5-tert-butyl-1,3-oxazole.
What is the SMILES notation for 5-tert-butyl-1-methylimidazole;2-tert-butyl-1,3-oxazole;5-tert-butyl-1,3-oxazole?
The canonical SMILES for 5-tert-butyl-1-methylimidazole;2-tert-butyl-1,3-oxazole;5-tert-butyl-1,3-oxazole is CC(C)(C)c1cnco1.CC(C)(C)c1ncco1.Cn1cncc1C(C)(C)C.
What is the InChIKey of 5-tert-butyl-1-methylimidazole;2-tert-butyl-1,3-oxazole;5-tert-butyl-1,3-oxazole?
The InChIKey is MUEROQRGUREWRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2.2C7H11NO/c1-8(2,3)7-5-9-6-10(7)4;1-7(2,3)6-4-8-5-9-6;1-7(2,3)6-8-4-5-9-6/h5-6H,1-4H3;2*4-5H,1-3H3.
What are the key properties of 5-tert-butyl-1-methylimidazole;2-tert-butyl-1,3-oxazole;5-tert-butyl-1,3-oxazole?
5-tert-butyl-1-methylimidazole;2-tert-butyl-1,3-oxazole;5-tert-butyl-1,3-oxazole has a molecular weight of 388.56 g/mol, XLogP of 5.66, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-1-methylimidazole;2-tert-butyl-1,3-oxazole;5-tert-butyl-1,3-oxazole is sourced from PubChem (CID 159672654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).