About 2-[[(E)-3-phenylprop-2-enylidene]amino]benzenethiolate;thallium(1+)
2-[[(E)-3-phenylprop-2-enylidene]amino]benzenethiolate;thallium(1+) (PubChem CID 15967282) has the molecular formula C15H12NSTl
and a molecular weight of 442.72 g/mol. Its IUPAC name is 2-[[(E)-3-phenylprop-2-enylidene]amino]benzenethiolate;thallium(1+).
Molecular Properties
| Compound Name | 2-[[(E)-3-phenylprop-2-enylidene]amino]benzenethiolate;thallium(1+) |
| PubChem CID | 15967282 |
| Molecular Formula | C15H12NSTl |
| Molecular Weight | 442.72 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | 2-[[(E)-3-phenylprop-2-enylidene]amino]benzenethiolate;thallium(1+) |
| SMILES | [S-]c1ccccc1/N=C/C=C/c1ccccc1.[Tl+] |
| InChI | InChI=1S/C15H13NS.Tl/c17-15-11-5-4-10-14(15)16-12-6-9-13-7-2-1-3-8-13;/h1-12,17H;/q;+1/p-1/b9-6+,16-12+; |
| InChIKey | MLGNFGYMXKIWNY-WOGOKGLQSA-M |
| XLogP | 3.63 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.72 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(E)-3-phenylprop-2-enylidene]amino]benzenethiolate;thallium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(E)-3-phenylprop-2-enylidene]amino]benzenethiolate;thallium(1+)?
The IUPAC name of 2-[[(E)-3-phenylprop-2-enylidene]amino]benzenethiolate;thallium(1+) (CID 15967282) is 2-[[(E)-3-phenylprop-2-enylidene]amino]benzenethiolate;thallium(1+).
What is the SMILES notation for 2-[[(E)-3-phenylprop-2-enylidene]amino]benzenethiolate;thallium(1+)?
The canonical SMILES for 2-[[(E)-3-phenylprop-2-enylidene]amino]benzenethiolate;thallium(1+) is [S-]c1ccccc1/N=C/C=C/c1ccccc1.[Tl+].
What is the InChIKey of 2-[[(E)-3-phenylprop-2-enylidene]amino]benzenethiolate;thallium(1+)?
The InChIKey is MLGNFGYMXKIWNY-WOGOKGLQSA-M. The full InChI is InChI=1S/C15H13NS.Tl/c17-15-11-5-4-10-14(15)16-12-6-9-13-7-2-1-3-8-13;/h1-12,17H;/q;+1/p-1/b9-6+,16-12+;.
What are the key properties of 2-[[(E)-3-phenylprop-2-enylidene]amino]benzenethiolate;thallium(1+)?
2-[[(E)-3-phenylprop-2-enylidene]amino]benzenethiolate;thallium(1+) has a molecular weight of 442.72 g/mol, XLogP of 3.63, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(E)-3-phenylprop-2-enylidene]amino]benzenethiolate;thallium(1+) is sourced from PubChem (CID 15967282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).