About 1-chloro-4-[(1R,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]phthalazine
1-chloro-4-[(1R,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]phthalazine (PubChem CID 15967372) has the molecular formula C13H13ClN4
and a molecular weight of 260.73 g/mol. Its IUPAC name is 1-chloro-4-[(1R,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]phthalazine.
Molecular Properties
| Compound Name | 1-chloro-4-[(1R,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]phthalazine |
| PubChem CID | 15967372 |
| Molecular Formula | C13H13ClN4 |
| Molecular Weight | 260.73 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 1-chloro-4-[(1R,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]phthalazine |
| SMILES | Clc1nnc(N2C[C@@H]3C[C@@H]2CN3)c2ccccc12 |
| InChI | InChI=1S/C13H13ClN4/c14-12-10-3-1-2-4-11(10)13(17-16-12)18-7-8-5-9(18)6-15-8/h1-4,8-9,15H,5-7H2/t8-,9+/m0/s1 |
| InChIKey | BYYIXAPRYVEOEB-DTWKUNHWSA-N |
| XLogP | 1.83 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.73 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-chloro-4-[(1R,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]phthalazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-[(1R,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]phthalazine?
The IUPAC name of 1-chloro-4-[(1R,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]phthalazine (CID 15967372) is 1-chloro-4-[(1R,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]phthalazine.
What is the SMILES notation for 1-chloro-4-[(1R,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]phthalazine?
The canonical SMILES for 1-chloro-4-[(1R,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]phthalazine is Clc1nnc(N2C[C@@H]3C[C@@H]2CN3)c2ccccc12.
What is the InChIKey of 1-chloro-4-[(1R,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]phthalazine?
The InChIKey is BYYIXAPRYVEOEB-DTWKUNHWSA-N. The full InChI is InChI=1S/C13H13ClN4/c14-12-10-3-1-2-4-11(10)13(17-16-12)18-7-8-5-9(18)6-15-8/h1-4,8-9,15H,5-7H2/t8-,9+/m0/s1.
What are the key properties of 1-chloro-4-[(1R,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]phthalazine?
1-chloro-4-[(1R,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]phthalazine has a molecular weight of 260.73 g/mol, XLogP of 1.83, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-[(1R,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]phthalazine is sourced from PubChem (CID 15967372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).