C42H70O4Si4 — CID 159675154
cyclohexylmethyl-ethenyl-[2,4,5-tris[[cyclohexylmethyl(ethenyl)silyl]oxy]phenoxy]silane (PubChem CID 159675154) has the molecular formula C42H70O4Si4 and a molecular weight of 751.36 g/mol. Its IUPAC name is cyclohexylmethyl-ethenyl-[2,4,5-tris[[cyclohexylmethyl(ethenyl)silyl]oxy]phenoxy]silane.
| Compound Name | cyclohexylmethyl-ethenyl-[2,4,5-tris[[cyclohexylmethyl(ethenyl)silyl]oxy]phenoxy]silane |
|---|---|
| PubChem CID | 159675154 |
| Molecular Formula | C42H70O4Si4 |
| Molecular Weight | 751.36 g/mol |
| Exact Mass | 750.44 |
| IUPAC Name | cyclohexylmethyl-ethenyl-[2,4,5-tris[[cyclohexylmethyl(ethenyl)silyl]oxy]phenoxy]silane |
| SMILES | C=C[SiH](CC1CCCCC1)Oc1cc(O[SiH](C=C)CC2CCCCC2)c(O[SiH](C=C)CC2CCCCC2)cc1O[SiH](C=C)CC1CCCCC1 |
| InChI | InChI=1S/C42H70O4Si4/c1-5-47(31-35-21-13-9-14-22-35)43-39-29-41(45-49(7-3)33-37-25-17-11-18-26-37)42(46-50(8-4)34-38-27-19-12-20-28-38)30-40(39)44-48(6-2)32-36-23-15-10-16-24-36/h5-8,29-30,35-38,47-50H,1-4,9-28,31-34H2 |
| InChIKey | MUMUTYMNXZWNPK-UHFFFAOYSA-N |
| XLogP | 11.32 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.36 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|