About 1-(4-piperazin-1-ylphenyl)propan-2-ol;1-(5-piperazin-1-yl-3-pyridinyl)ethanol
1-(4-piperazin-1-ylphenyl)propan-2-ol;1-(5-piperazin-1-yl-3-pyridinyl)ethanol (PubChem CID 159676259) has the molecular formula C24H37N5O2
and a molecular weight of 427.59 g/mol. Its IUPAC name is 1-(4-piperazin-1-ylphenyl)propan-2-ol;1-(5-piperazin-1-yl-3-pyridinyl)ethanol.
Molecular Properties
| Compound Name | 1-(4-piperazin-1-ylphenyl)propan-2-ol;1-(5-piperazin-1-yl-3-pyridinyl)ethanol |
| PubChem CID | 159676259 |
| Molecular Formula | C24H37N5O2 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.29 |
| IUPAC Name | 1-(4-piperazin-1-ylphenyl)propan-2-ol;1-(5-piperazin-1-yl-3-pyridinyl)ethanol |
| SMILES | CC(O)Cc1ccc(N2CCNCC2)cc1.CC(O)c1cncc(N2CCNCC2)c1 |
| InChI | InChI=1S/C13H20N2O.C11H17N3O/c1-11(16)10-12-2-4-13(5-3-12)15-8-6-14-7-9-15;1-9(15)10-6-11(8-13-7-10)14-4-2-12-3-5-14/h2-5,11,14,16H,6-10H2,1H3;6-9,12,15H,2-5H2,1H3 |
| InChIKey | MUQBYSXPNYDDJH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-piperazin-1-ylphenyl)propan-2-ol;1-(5-piperazin-1-yl-3-pyridinyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-piperazin-1-ylphenyl)propan-2-ol;1-(5-piperazin-1-yl-3-pyridinyl)ethanol?
The IUPAC name of 1-(4-piperazin-1-ylphenyl)propan-2-ol;1-(5-piperazin-1-yl-3-pyridinyl)ethanol (CID 159676259) is 1-(4-piperazin-1-ylphenyl)propan-2-ol;1-(5-piperazin-1-yl-3-pyridinyl)ethanol.
What is the SMILES notation for 1-(4-piperazin-1-ylphenyl)propan-2-ol;1-(5-piperazin-1-yl-3-pyridinyl)ethanol?
The canonical SMILES for 1-(4-piperazin-1-ylphenyl)propan-2-ol;1-(5-piperazin-1-yl-3-pyridinyl)ethanol is CC(O)Cc1ccc(N2CCNCC2)cc1.CC(O)c1cncc(N2CCNCC2)c1.
What is the InChIKey of 1-(4-piperazin-1-ylphenyl)propan-2-ol;1-(5-piperazin-1-yl-3-pyridinyl)ethanol?
The InChIKey is MUQBYSXPNYDDJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O.C11H17N3O/c1-11(16)10-12-2-4-13(5-3-12)15-8-6-14-7-9-15;1-9(15)10-6-11(8-13-7-10)14-4-2-12-3-5-14/h2-5,11,14,16H,6-10H2,1H3;6-9,12,15H,2-5H2,1H3.
What are the key properties of 1-(4-piperazin-1-ylphenyl)propan-2-ol;1-(5-piperazin-1-yl-3-pyridinyl)ethanol?
1-(4-piperazin-1-ylphenyl)propan-2-ol;1-(5-piperazin-1-yl-3-pyridinyl)ethanol has a molecular weight of 427.59 g/mol, XLogP of 1.56, 5 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-piperazin-1-ylphenyl)propan-2-ol;1-(5-piperazin-1-yl-3-pyridinyl)ethanol is sourced from PubChem (CID 159676259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).