C12H22N2 — CID 159678911
(3S,6S)-1-buta-1,3-dien-2-yl-N,N,6-trimethylpiperidin-3-amine (PubChem CID 159678911) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is (3S,6S)-1-buta-1,3-dien-2-yl-N,N,6-trimethylpiperidin-3-amine.
| Compound Name | (3S,6S)-1-buta-1,3-dien-2-yl-N,N,6-trimethylpiperidin-3-amine |
|---|---|
| PubChem CID | 159678911 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | (3S,6S)-1-buta-1,3-dien-2-yl-N,N,6-trimethylpiperidin-3-amine |
| SMILES | C=CC(=C)N1C[C@@H](N(C)C)CC[C@@H]1C |
| InChI | InChI=1S/C12H22N2/c1-6-10(2)14-9-12(13(4)5)8-7-11(14)3/h6,11-12H,1-2,7-9H2,3-5H3/t11-,12-/m0/s1 |
| InChIKey | JYPCAXRTHBGJGY-RYUDHWBXSA-N |
| XLogP | 2.10 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|