C18H18F6N2O7 — CID 159678987
methanol;1-methoxy-3-methyl-2-nitro-4-(trifluoromethyl)benzene;1-methoxy-2-nitro-4-(trifluoromethyl)benzene (PubChem CID 159678987) has the molecular formula C18H18F6N2O7 and a molecular weight of 488.34 g/mol. Its IUPAC name is methanol;1-methoxy-3-methyl-2-nitro-4-(trifluoromethyl)benzene;1-methoxy-2-nitro-4-(trifluoromethyl)benzene.
| Compound Name | methanol;1-methoxy-3-methyl-2-nitro-4-(trifluoromethyl)benzene;1-methoxy-2-nitro-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 159678987 |
| Molecular Formula | C18H18F6N2O7 |
| Molecular Weight | 488.34 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | methanol;1-methoxy-3-methyl-2-nitro-4-(trifluoromethyl)benzene;1-methoxy-2-nitro-4-(trifluoromethyl)benzene |
| SMILES | CO.COc1ccc(C(F)(F)F)c(C)c1[N+](=O)[O-].COc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H8F3NO3.C8H6F3NO3.CH4O/c1-5-6(9(10,11)12)3-4-7(16-2)8(5)13(14)15;1-15-7-3-2-5(8(9,10)11)4-6(7)12(13)14;1-2/h3-4H,1-2H3;2-4H,1H3;2H,1H3 |
| InChIKey | MUYZBYNTOAYSSL-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 124.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.34 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|