C51H83B4NO8S4 — CID 159679329
CID 159679329 (PubChem CID 159679329) has the molecular formula C51H83B4NO8S4 and a molecular weight of 1017.77 g/mol.
| Compound Name | CID 159679329 |
|---|---|
| PubChem CID | 159679329 |
| Molecular Formula | C51H83B4NO8S4 |
| Molecular Weight | 1017.77 g/mol |
| Exact Mass | 1017.57 |
| IUPAC Name | — |
| SMILES | C.[3H][B]SO[C@@H]1CC2=CC=C3C4CC[C@H](COCCC(=O)N(C)C)[C@@]4(C)CCC3[C@@]2(C)[C@@H](OS[B][3H])C1.[3H][B]SO[C@@H]1CC2=CC=C3C4CC[C@H](COCCC(C)(C)O)[C@@]4(C)CCC3[C@@]2(C)[C@@H](OS[B][3H])C1 |
| InChI | InChI=1S/C25H39B2NO4S2.C25H40B2O4S2.CH4/c1-24-11-9-21-19(20(24)8-6-17(24)15-30-12-10-23(29)28(3)4)7-5-16-13-18(31-33-26)14-22(32-34-27)25(16,21)2;1-23(2,28)11-12-29-15-17-6-8-20-19-7-5-16-13-18(30-32-26)14-22(31-33-27)25(16,4)21(19)9-10-24(17,20)3;/h5,7,17-18,20-22,26-27H,6,8-15H2,1-4H3;5,7,17-18,20-22,26-28H,6,8-15H2,1-4H3;1H4/t2*17-,18-,20?,21?,22+,24-,25+;/m11./s1/i2*26T,27T; |
| InChIKey | VGJCRRJZHSWQAL-YKIDAWJRSA-N |
| XLogP | 9.90 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1017.77 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|