About lithium;sodium;(1Z)-N-(benzenesulfonyl)propanimidate
lithium;sodium;(1Z)-N-(benzenesulfonyl)propanimidate (PubChem CID 15967997) has the molecular formula C9H9LiNNaO3S
and a molecular weight of 241.17 g/mol. Its IUPAC name is lithium;sodium;(1Z)-N-(benzenesulfonyl)propanimidate.
Molecular Properties
| Compound Name | lithium;sodium;(1Z)-N-(benzenesulfonyl)propanimidate |
| PubChem CID | 15967997 |
| Molecular Formula | C9H9LiNNaO3S |
| Molecular Weight | 241.17 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | lithium;sodium;(1Z)-N-(benzenesulfonyl)propanimidate |
| SMILES | [CH2-]C/C([O-])=N/S(=O)(=O)c1ccccc1.[Li+].[Na+] |
| InChI | InChI=1S/C9H10NO3S.Li.Na/c1-2-9(11)10-14(12,13)8-6-4-3-5-7-8;;/h3-7H,1-2H2,(H,10,11);;/q-1;2*+1/p-1 |
| InChIKey | GKPBCJYHAZNTFI-UHFFFAOYSA-M |
| XLogP | -5.63 |
| TPSA | 69.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.17 |
| LogP ≤ 5 | -5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze lithium;sodium;(1Z)-N-(benzenesulfonyl)propanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;sodium;(1Z)-N-(benzenesulfonyl)propanimidate?
The IUPAC name of lithium;sodium;(1Z)-N-(benzenesulfonyl)propanimidate (CID 15967997) is lithium;sodium;(1Z)-N-(benzenesulfonyl)propanimidate.
What is the SMILES notation for lithium;sodium;(1Z)-N-(benzenesulfonyl)propanimidate?
The canonical SMILES for lithium;sodium;(1Z)-N-(benzenesulfonyl)propanimidate is [CH2-]C/C([O-])=N/S(=O)(=O)c1ccccc1.[Li+].[Na+].
What is the InChIKey of lithium;sodium;(1Z)-N-(benzenesulfonyl)propanimidate?
The InChIKey is GKPBCJYHAZNTFI-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H10NO3S.Li.Na/c1-2-9(11)10-14(12,13)8-6-4-3-5-7-8;;/h3-7H,1-2H2,(H,10,11);;/q-1;2*+1/p-1.
What are the key properties of lithium;sodium;(1Z)-N-(benzenesulfonyl)propanimidate?
lithium;sodium;(1Z)-N-(benzenesulfonyl)propanimidate has a molecular weight of 241.17 g/mol, XLogP of -5.63, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;sodium;(1Z)-N-(benzenesulfonyl)propanimidate is sourced from PubChem (CID 15967997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).