C9H5F5N2S — CID 159681415
5-(2,3,4,5,6-pentafluorophenyl)-1H-pyrazole;sulfane (PubChem CID 159681415) has the molecular formula C9H5F5N2S and a molecular weight of 268.21 g/mol. Its IUPAC name is 5-(2,3,4,5,6-pentafluorophenyl)-1H-pyrazole;sulfane.
| Compound Name | 5-(2,3,4,5,6-pentafluorophenyl)-1H-pyrazole;sulfane |
|---|---|
| PubChem CID | 159681415 |
| Molecular Formula | C9H5F5N2S |
| Molecular Weight | 268.21 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 5-(2,3,4,5,6-pentafluorophenyl)-1H-pyrazole;sulfane |
| SMILES | Fc1c(F)c(F)c(-c2ccn[nH]2)c(F)c1F.S |
| InChI | InChI=1S/C9H3F5N2.H2S/c10-5-4(3-1-2-15-16-3)6(11)8(13)9(14)7(5)12;/h1-2H,(H,15,16);1H2 |
| InChIKey | HMJJXOADRBXHIR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.21 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|