About zinc;1-diazo-4-nitro-2H-naphthalene;dichloride
zinc;1-diazo-4-nitro-2H-naphthalene;dichloride (PubChem CID 159681963) has the molecular formula C10H7Cl2N3O2Zn
and a molecular weight of 337.48 g/mol. Its IUPAC name is zinc;1-diazo-4-nitro-2H-naphthalene;dichloride.
Molecular Properties
| Compound Name | zinc;1-diazo-4-nitro-2H-naphthalene;dichloride |
| PubChem CID | 159681963 |
| Molecular Formula | C10H7Cl2N3O2Zn |
| Molecular Weight | 337.48 g/mol |
| Exact Mass | 334.92 |
| IUPAC Name | zinc;1-diazo-4-nitro-2H-naphthalene;dichloride |
| SMILES | [Cl-].[Cl-].[N-]=[N+]=C1CC=C([N+](=O)[O-])c2ccccc21.[Zn+2] |
| InChI | InChI=1S/C10H7N3O2.2ClH.Zn/c11-12-9-5-6-10(13(14)15)8-4-2-1-3-7(8)9;;;/h1-4,6H,5H2;2*1H;/q;;;+2/p-2 |
| InChIKey | MVHYITRBRRTPRL-UHFFFAOYSA-L |
| XLogP | -4.27 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.48 |
| LogP ≤ 5 | -4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|
Analyze zinc;1-diazo-4-nitro-2H-naphthalene;dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;1-diazo-4-nitro-2H-naphthalene;dichloride?
The IUPAC name of zinc;1-diazo-4-nitro-2H-naphthalene;dichloride (CID 159681963) is zinc;1-diazo-4-nitro-2H-naphthalene;dichloride.
What is the SMILES notation for zinc;1-diazo-4-nitro-2H-naphthalene;dichloride?
The canonical SMILES for zinc;1-diazo-4-nitro-2H-naphthalene;dichloride is [Cl-].[Cl-].[N-]=[N+]=C1CC=C([N+](=O)[O-])c2ccccc21.[Zn+2].
What is the InChIKey of zinc;1-diazo-4-nitro-2H-naphthalene;dichloride?
The InChIKey is MVHYITRBRRTPRL-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H7N3O2.2ClH.Zn/c11-12-9-5-6-10(13(14)15)8-4-2-1-3-7(8)9;;;/h1-4,6H,5H2;2*1H;/q;;;+2/p-2.
What are the key properties of zinc;1-diazo-4-nitro-2H-naphthalene;dichloride?
zinc;1-diazo-4-nitro-2H-naphthalene;dichloride has a molecular weight of 337.48 g/mol, XLogP of -4.27, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;1-diazo-4-nitro-2H-naphthalene;dichloride is sourced from PubChem (CID 159681963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).