About butan-2-one;1,6-diisocyanatohexane
butan-2-one;1,6-diisocyanatohexane (PubChem CID 159682468) has the molecular formula C12H20N2O3
and a molecular weight of 240.30 g/mol. Its IUPAC name is butan-2-one;1,6-diisocyanatohexane.
Molecular Properties
| Compound Name | butan-2-one;1,6-diisocyanatohexane |
| PubChem CID | 159682468 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | butan-2-one;1,6-diisocyanatohexane |
| SMILES | CCC(C)=O.O=C=NCCCCCCN=C=O |
| InChI | InChI=1S/C8H12N2O2.C4H8O/c11-7-9-5-3-1-2-4-6-10-8-12;1-3-4(2)5/h1-6H2;3H2,1-2H3 |
| InChIKey | MVJJYGYKMCTOTE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 75.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze butan-2-one;1,6-diisocyanatohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-one;1,6-diisocyanatohexane?
The IUPAC name of butan-2-one;1,6-diisocyanatohexane (CID 159682468) is butan-2-one;1,6-diisocyanatohexane.
What is the SMILES notation for butan-2-one;1,6-diisocyanatohexane?
The canonical SMILES for butan-2-one;1,6-diisocyanatohexane is CCC(C)=O.O=C=NCCCCCCN=C=O.
What is the InChIKey of butan-2-one;1,6-diisocyanatohexane?
The InChIKey is MVJJYGYKMCTOTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2.C4H8O/c11-7-9-5-3-1-2-4-6-10-8-12;1-3-4(2)5/h1-6H2;3H2,1-2H3.
What are the key properties of butan-2-one;1,6-diisocyanatohexane?
butan-2-one;1,6-diisocyanatohexane has a molecular weight of 240.30 g/mol, XLogP of 2.20, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-one;1,6-diisocyanatohexane is sourced from PubChem (CID 159682468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).