About (4R)-5-fluoro-6-methoxy-4,5-dimethylhept-1-ene
(4R)-5-fluoro-6-methoxy-4,5-dimethylhept-1-ene (PubChem CID 159682763) has the molecular formula C10H19FO
and a molecular weight of 174.26 g/mol. Its IUPAC name is (4R)-5-fluoro-6-methoxy-4,5-dimethylhept-1-ene.
Molecular Properties
| Compound Name | (4R)-5-fluoro-6-methoxy-4,5-dimethylhept-1-ene |
| PubChem CID | 159682763 |
| Molecular Formula | C10H19FO |
| Molecular Weight | 174.26 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | (4R)-5-fluoro-6-methoxy-4,5-dimethylhept-1-ene |
| SMILES | C=CC[C@@H](C)C(C)(F)C(C)OC |
| InChI | InChI=1S/C10H19FO/c1-6-7-8(2)10(4,11)9(3)12-5/h6,8-9H,1,7H2,2-5H3/t8-,9?,10?/m1/s1 |
| InChIKey | MVKHFKXLWPJERB-XNWIYYODSA-N |
| XLogP | 2.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.26 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4R)-5-fluoro-6-methoxy-4,5-dimethylhept-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-5-fluoro-6-methoxy-4,5-dimethylhept-1-ene?
The IUPAC name of (4R)-5-fluoro-6-methoxy-4,5-dimethylhept-1-ene (CID 159682763) is (4R)-5-fluoro-6-methoxy-4,5-dimethylhept-1-ene.
What is the SMILES notation for (4R)-5-fluoro-6-methoxy-4,5-dimethylhept-1-ene?
The canonical SMILES for (4R)-5-fluoro-6-methoxy-4,5-dimethylhept-1-ene is C=CC[C@@H](C)C(C)(F)C(C)OC.
What is the InChIKey of (4R)-5-fluoro-6-methoxy-4,5-dimethylhept-1-ene?
The InChIKey is MVKHFKXLWPJERB-XNWIYYODSA-N. The full InChI is InChI=1S/C10H19FO/c1-6-7-8(2)10(4,11)9(3)12-5/h6,8-9H,1,7H2,2-5H3/t8-,9?,10?/m1/s1.
What are the key properties of (4R)-5-fluoro-6-methoxy-4,5-dimethylhept-1-ene?
(4R)-5-fluoro-6-methoxy-4,5-dimethylhept-1-ene has a molecular weight of 174.26 g/mol, XLogP of 2.96, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-5-fluoro-6-methoxy-4,5-dimethylhept-1-ene is sourced from PubChem (CID 159682763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).