C19H19N3O3 — CID 159682793
7-[(1S,2S,3R,4R)-2,3-dihydroxy-4-[(E)-2-phenylethenyl]cyclopentyl]-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 159682793) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is 7-[(1S,2S,3R,4R)-2,3-dihydroxy-4-[(E)-2-phenylethenyl]cyclopentyl]-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one.
| Compound Name | 7-[(1S,2S,3R,4R)-2,3-dihydroxy-4-[(E)-2-phenylethenyl]cyclopentyl]-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 159682793 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 7-[(1S,2S,3R,4R)-2,3-dihydroxy-4-[(E)-2-phenylethenyl]cyclopentyl]-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | O=c1[nH]cnc2c([C@@H]3C[C@H](/C=C/c4ccccc4)[C@@H](O)[C@H]3O)c[nH]c12 |
| InChI | InChI=1S/C19H19N3O3/c23-17-12(7-6-11-4-2-1-3-5-11)8-13(18(17)24)14-9-20-16-15(14)21-10-22-19(16)25/h1-7,9-10,12-13,17-18,20,23-24H,8H2,(H,21,22,25)/b7-6+/t12-,13-,17+,18-/m0/s1 |
| InChIKey | BQTCJHBCTAPQCJ-CAVACGJNSA-N |
| XLogP | 1.79 |
| TPSA | 102.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |