About 4-(5-bromopyrimidin-2-yl)oxan-4-ol;oxan-4-one
4-(5-bromopyrimidin-2-yl)oxan-4-ol;oxan-4-one (PubChem CID 159685962) has the molecular formula C14H19BrN2O4
and a molecular weight of 359.22 g/mol. Its IUPAC name is 4-(5-bromopyrimidin-2-yl)oxan-4-ol;oxan-4-one.
Molecular Properties
| Compound Name | 4-(5-bromopyrimidin-2-yl)oxan-4-ol;oxan-4-one |
| PubChem CID | 159685962 |
| Molecular Formula | C14H19BrN2O4 |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | 4-(5-bromopyrimidin-2-yl)oxan-4-ol;oxan-4-one |
| SMILES | O=C1CCOCC1.OC1(c2ncc(Br)cn2)CCOCC1 |
| InChI | InChI=1S/C9H11BrN2O2.C5H8O2/c10-7-5-11-8(12-6-7)9(13)1-3-14-4-2-9;6-5-1-3-7-4-2-5/h5-6,13H,1-4H2;1-4H2 |
| InChIKey | MVULVUVVLHHQGS-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(5-bromopyrimidin-2-yl)oxan-4-ol;oxan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-bromopyrimidin-2-yl)oxan-4-ol;oxan-4-one?
The IUPAC name of 4-(5-bromopyrimidin-2-yl)oxan-4-ol;oxan-4-one (CID 159685962) is 4-(5-bromopyrimidin-2-yl)oxan-4-ol;oxan-4-one.
What is the SMILES notation for 4-(5-bromopyrimidin-2-yl)oxan-4-ol;oxan-4-one?
The canonical SMILES for 4-(5-bromopyrimidin-2-yl)oxan-4-ol;oxan-4-one is O=C1CCOCC1.OC1(c2ncc(Br)cn2)CCOCC1.
What is the InChIKey of 4-(5-bromopyrimidin-2-yl)oxan-4-ol;oxan-4-one?
The InChIKey is MVULVUVVLHHQGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BrN2O2.C5H8O2/c10-7-5-11-8(12-6-7)9(13)1-3-14-4-2-9;6-5-1-3-7-4-2-5/h5-6,13H,1-4H2;1-4H2.
What are the key properties of 4-(5-bromopyrimidin-2-yl)oxan-4-ol;oxan-4-one?
4-(5-bromopyrimidin-2-yl)oxan-4-ol;oxan-4-one has a molecular weight of 359.22 g/mol, XLogP of 1.60, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-bromopyrimidin-2-yl)oxan-4-ol;oxan-4-one is sourced from PubChem (CID 159685962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).