About 4-hydroxy-2-(2-hydroxyethoxy)butanoate;dihydrate
4-hydroxy-2-(2-hydroxyethoxy)butanoate;dihydrate (PubChem CID 159686152) has the molecular formula C6H15O7-
and a molecular weight of 199.18 g/mol. Its IUPAC name is 4-hydroxy-2-(2-hydroxyethoxy)butanoate;dihydrate.
Molecular Properties
| Compound Name | 4-hydroxy-2-(2-hydroxyethoxy)butanoate;dihydrate |
| PubChem CID | 159686152 |
| Molecular Formula | C6H15O7- |
| Molecular Weight | 199.18 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 4-hydroxy-2-(2-hydroxyethoxy)butanoate;dihydrate |
| SMILES | O.O.O=C([O-])C(CCO)OCCO |
| InChI | InChI=1S/C6H12O5.2H2O/c7-2-1-5(6(9)10)11-4-3-8;;/h5,7-8H,1-4H2,(H,9,10);2*1H2/p-1 |
| InChIKey | AOYLHJSRXKNJQJ-UHFFFAOYSA-M |
| XLogP | -4.15 |
| TPSA | 152.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.18 |
| LogP ≤ 5 | -4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-hydroxy-2-(2-hydroxyethoxy)butanoate;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-2-(2-hydroxyethoxy)butanoate;dihydrate?
The IUPAC name of 4-hydroxy-2-(2-hydroxyethoxy)butanoate;dihydrate (CID 159686152) is 4-hydroxy-2-(2-hydroxyethoxy)butanoate;dihydrate.
What is the SMILES notation for 4-hydroxy-2-(2-hydroxyethoxy)butanoate;dihydrate?
The canonical SMILES for 4-hydroxy-2-(2-hydroxyethoxy)butanoate;dihydrate is O.O.O=C([O-])C(CCO)OCCO.
What is the InChIKey of 4-hydroxy-2-(2-hydroxyethoxy)butanoate;dihydrate?
The InChIKey is AOYLHJSRXKNJQJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H12O5.2H2O/c7-2-1-5(6(9)10)11-4-3-8;;/h5,7-8H,1-4H2,(H,9,10);2*1H2/p-1.
What are the key properties of 4-hydroxy-2-(2-hydroxyethoxy)butanoate;dihydrate?
4-hydroxy-2-(2-hydroxyethoxy)butanoate;dihydrate has a molecular weight of 199.18 g/mol, XLogP of -4.15, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-2-(2-hydroxyethoxy)butanoate;dihydrate is sourced from PubChem (CID 159686152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).