C16H19ClN4O4S — CID 159686295
5-chloro-N-methanehydrazonoyl-1-azatricyclo[6.5.1.04,14]tetradeca-2,4,6,8(14),9-pentaene-2-carboxamide;methanesulfonic acid (PubChem CID 159686295) has the molecular formula C16H19ClN4O4S and a molecular weight of 398.87 g/mol. Its IUPAC name is 5-chloro-N-methanehydrazonoyl-1-azatricyclo[6.5.1.04,14]tetradeca-2,4,6,8(14),9-pentaene-2-carboxamide;methanesulfonic acid.
| Compound Name | 5-chloro-N-methanehydrazonoyl-1-azatricyclo[6.5.1.04,14]tetradeca-2,4,6,8(14),9-pentaene-2-carboxamide;methanesulfonic acid |
|---|---|
| PubChem CID | 159686295 |
| Molecular Formula | C16H19ClN4O4S |
| Molecular Weight | 398.87 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 5-chloro-N-methanehydrazonoyl-1-azatricyclo[6.5.1.04,14]tetradeca-2,4,6,8(14),9-pentaene-2-carboxamide;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.NN=CNC(=O)c1cc2c(Cl)ccc3c2n1CCCC=C3 |
| InChI | InChI=1S/C15H15ClN4O.CH4O3S/c16-12-6-5-10-4-2-1-3-7-20-13(8-11(12)14(10)20)15(21)18-9-19-17;1-5(2,3)4/h2,4-6,8-9H,1,3,7,17H2,(H,18,19,21);1H3,(H,2,3,4) |
| InChIKey | MVVMKHOORSHHAU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 126.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.87 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|