C12H24FNO — CID 159687075
(3S,4S)-3-fluoro-4-methyl-1-[3-[(2-methylpropan-2-yl)oxy]propyl]pyrrolidine (PubChem CID 159687075) has the molecular formula C12H24FNO and a molecular weight of 217.33 g/mol. Its IUPAC name is (3S,4S)-3-fluoro-4-methyl-1-[3-[(2-methylpropan-2-yl)oxy]propyl]pyrrolidine.
| Compound Name | (3S,4S)-3-fluoro-4-methyl-1-[3-[(2-methylpropan-2-yl)oxy]propyl]pyrrolidine |
|---|---|
| PubChem CID | 159687075 |
| Molecular Formula | C12H24FNO |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | (3S,4S)-3-fluoro-4-methyl-1-[3-[(2-methylpropan-2-yl)oxy]propyl]pyrrolidine |
| SMILES | C[C@H]1CN(CCCOC(C)(C)C)C[C@H]1F |
| InChI | InChI=1S/C12H24FNO/c1-10-8-14(9-11(10)13)6-5-7-15-12(2,3)4/h10-11H,5-9H2,1-4H3/t10-,11+/m0/s1 |
| InChIKey | NRUHYEJJGKUTGI-WDEREUQCSA-N |
| XLogP | 2.48 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|