About ethylideneplatinum;methylsulfinylmethane
ethylideneplatinum;methylsulfinylmethane (PubChem CID 159687651) has the molecular formula C4H10OPtS
and a molecular weight of 301.27 g/mol. Its IUPAC name is ethylideneplatinum;methylsulfinylmethane.
Molecular Properties
| Compound Name | ethylideneplatinum;methylsulfinylmethane |
| PubChem CID | 159687651 |
| Molecular Formula | C4H10OPtS |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | ethylideneplatinum;methylsulfinylmethane |
| SMILES | CC=[Pt].CS(C)=O |
| InChI | InChI=1S/C2H6OS.C2H4.Pt/c1-4(2)3;1-2;/h1-2H3;1H,2H3; |
| InChIKey | MXJLOWHGDNMZRW-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethylideneplatinum;methylsulfinylmethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylideneplatinum;methylsulfinylmethane?
The IUPAC name of ethylideneplatinum;methylsulfinylmethane (CID 159687651) is ethylideneplatinum;methylsulfinylmethane.
What is the SMILES notation for ethylideneplatinum;methylsulfinylmethane?
The canonical SMILES for ethylideneplatinum;methylsulfinylmethane is CC=[Pt].CS(C)=O.
What is the InChIKey of ethylideneplatinum;methylsulfinylmethane?
The InChIKey is MXJLOWHGDNMZRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6OS.C2H4.Pt/c1-4(2)3;1-2;/h1-2H3;1H,2H3;.
What are the key properties of ethylideneplatinum;methylsulfinylmethane?
ethylideneplatinum;methylsulfinylmethane has a molecular weight of 301.27 g/mol, XLogP of 0.35, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethylideneplatinum;methylsulfinylmethane is sourced from PubChem (CID 159687651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).