C15H24O3S — CID 159688108
2,4,6-tri(propan-2-yloxy)benzenethiol (PubChem CID 159688108) has the molecular formula C15H24O3S and a molecular weight of 284.42 g/mol. Its IUPAC name is 2,4,6-tri(propan-2-yloxy)benzenethiol.
| Compound Name | 2,4,6-tri(propan-2-yloxy)benzenethiol |
|---|---|
| PubChem CID | 159688108 |
| Molecular Formula | C15H24O3S |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 2,4,6-tri(propan-2-yloxy)benzenethiol |
| SMILES | CC(C)Oc1cc(OC(C)C)c(S)c(OC(C)C)c1 |
| InChI | InChI=1S/C15H24O3S/c1-9(2)16-12-7-13(17-10(3)4)15(19)14(8-12)18-11(5)6/h7-11,19H,1-6H3 |
| InChIKey | MWBCQPMENDLPRV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|