About CID 159688111
CID 159688111 (PubChem CID 159688111) has the molecular formula C32H45B3BrN2O10
and a molecular weight of 730.06 g/mol.
Molecular Properties
| Compound Name | CID 159688111 |
| PubChem CID | 159688111 |
| Molecular Formula | C32H45B3BrN2O10 |
| Molecular Weight | 730.06 g/mol |
| Exact Mass | 729.25 |
| IUPAC Name | — |
| SMILES | CC1(C)OB(B2OC(C)(C)C(C)(C)O2)OC1(C)C.COC(=O)C1(c2cncc(Br)c2)CC1.COC(=O)C1(c2cncc(O[B]O)c2)CC1 |
| InChI | InChI=1S/C12H24B2O4.C10H11BNO4.C10H10BrNO2/c1-9(2)10(3,4)16-13(15-9)14-17-11(5,6)12(7,8)18-14;1-15-9(13)10(2-3-10)7-4-8(16-11-14)6-12-5-7;1-14-9(13)10(2-3-10)7-4-8(11)6-12-5-7/h1-8H3;4-6,14H,2-3H2,1H3;4-6H,2-3H2,1H3 |
| InChIKey | PCBPRRKSCGKYCL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 144.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 730.06 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 159688111 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159688111?
The IUPAC name of CID 159688111 (CID 159688111) is not available.
What is the SMILES notation for CID 159688111?
The canonical SMILES for CID 159688111 is CC1(C)OB(B2OC(C)(C)C(C)(C)O2)OC1(C)C.COC(=O)C1(c2cncc(Br)c2)CC1.COC(=O)C1(c2cncc(O[B]O)c2)CC1.
What is the InChIKey of CID 159688111?
The InChIKey is PCBPRRKSCGKYCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24B2O4.C10H11BNO4.C10H10BrNO2/c1-9(2)10(3,4)16-13(15-9)14-17-11(5,6)12(7,8)18-14;1-15-9(13)10(2-3-10)7-4-8(16-11-14)6-12-5-7;1-14-9(13)10(2-3-10)7-4-8(11)6-12-5-7/h1-8H3;4-6,14H,2-3H2,1H3;4-6H,2-3H2,1H3.
What are the key properties of CID 159688111?
CID 159688111 has a molecular weight of 730.06 g/mol, XLogP of 4.49, 7 rotatable bonds, 1 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159688111 is sourced from PubChem (CID 159688111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).