C7H9O8P2+ — CID 159688275
2-hydroxy-1,3,6,9,11-pentaoxa-2λ5-phospha-10-phosphoniacyclotetradeca-4,7,12-triene 2,10-dioxide (PubChem CID 159688275) has the molecular formula C7H9O8P2+ and a molecular weight of 283.09 g/mol. Its IUPAC name is 2-hydroxy-1,3,6,9,11-pentaoxa-2λ5-phospha-10-phosphoniacyclotetradeca-4,7,12-triene 2,10-dioxide.
| Compound Name | 2-hydroxy-1,3,6,9,11-pentaoxa-2λ5-phospha-10-phosphoniacyclotetradeca-4,7,12-triene 2,10-dioxide |
|---|---|
| PubChem CID | 159688275 |
| Molecular Formula | C7H9O8P2+ |
| Molecular Weight | 283.09 g/mol |
| Exact Mass | 282.98 |
| IUPAC Name | 2-hydroxy-1,3,6,9,11-pentaoxa-2λ5-phospha-10-phosphoniacyclotetradeca-4,7,12-triene 2,10-dioxide |
| SMILES | O=[P+]1OC=CCOP(=O)(O)OC=COC=CO1 |
| InChI | InChI=1S/C7H8O8P2/c8-16-12-2-1-3-14-17(9,10)15-7-5-11-4-6-13-16/h1-2,4-7H,3H2/p+1 |
| InChIKey | JYUJPASAZIMHMY-UHFFFAOYSA-O |
| XLogP | 2.30 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.09 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|