About bis(oxygen(2-));1,1,2,2-tetrachloroethene;titanium(4+)
bis(oxygen(2-));1,1,2,2-tetrachloroethene;titanium(4+) (PubChem CID 159688834) has the molecular formula C2Cl4O2Ti
and a molecular weight of 245.70 g/mol. Its IUPAC name is bis(oxygen(2-));1,1,2,2-tetrachloroethene;titanium(4+).
Molecular Properties
| Compound Name | bis(oxygen(2-));1,1,2,2-tetrachloroethene;titanium(4+) |
| PubChem CID | 159688834 |
| Molecular Formula | C2Cl4O2Ti |
| Molecular Weight | 245.70 g/mol |
| Exact Mass | 243.81 |
| IUPAC Name | bis(oxygen(2-));1,1,2,2-tetrachloroethene;titanium(4+) |
| SMILES | ClC(Cl)=C(Cl)Cl.[O-2].[O-2].[Ti+4] |
| InChI | InChI=1S/C2Cl4.2O.Ti/c3-1(4)2(5)6;;;/q;2*-2;+4 |
| InChIKey | MWDOEHHYODOLAJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 57.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.70 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze bis(oxygen(2-));1,1,2,2-tetrachloroethene;titanium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(oxygen(2-));1,1,2,2-tetrachloroethene;titanium(4+)?
The IUPAC name of bis(oxygen(2-));1,1,2,2-tetrachloroethene;titanium(4+) (CID 159688834) is bis(oxygen(2-));1,1,2,2-tetrachloroethene;titanium(4+).
What is the SMILES notation for bis(oxygen(2-));1,1,2,2-tetrachloroethene;titanium(4+)?
The canonical SMILES for bis(oxygen(2-));1,1,2,2-tetrachloroethene;titanium(4+) is ClC(Cl)=C(Cl)Cl.[O-2].[O-2].[Ti+4].
What is the InChIKey of bis(oxygen(2-));1,1,2,2-tetrachloroethene;titanium(4+)?
The InChIKey is MWDOEHHYODOLAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2Cl4.2O.Ti/c3-1(4)2(5)6;;;/q;2*-2;+4.
What are the key properties of bis(oxygen(2-));1,1,2,2-tetrachloroethene;titanium(4+)?
bis(oxygen(2-));1,1,2,2-tetrachloroethene;titanium(4+) has a molecular weight of 245.70 g/mol, XLogP of 2.83, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(oxygen(2-));1,1,2,2-tetrachloroethene;titanium(4+) is sourced from PubChem (CID 159688834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).