About 3-tert-butylpyridine;3-tert-butylthiophene
3-tert-butylpyridine;3-tert-butylthiophene (PubChem CID 159689171) has the molecular formula C17H25NS
and a molecular weight of 275.46 g/mol. Its IUPAC name is 3-tert-butylpyridine;3-tert-butylthiophene.
Molecular Properties
| Compound Name | 3-tert-butylpyridine;3-tert-butylthiophene |
| PubChem CID | 159689171 |
| Molecular Formula | C17H25NS |
| Molecular Weight | 275.46 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 3-tert-butylpyridine;3-tert-butylthiophene |
| SMILES | CC(C)(C)c1cccnc1.CC(C)(C)c1ccsc1 |
| InChI | InChI=1S/C9H13N.C8H12S/c1-9(2,3)8-5-4-6-10-7-8;1-8(2,3)7-4-5-9-6-7/h4-7H,1-3H3;4-6H,1-3H3 |
| InChIKey | MWEOELZFOZMRTJ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 275.46 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-tert-butylpyridine;3-tert-butylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butylpyridine;3-tert-butylthiophene?
The IUPAC name of 3-tert-butylpyridine;3-tert-butylthiophene (CID 159689171) is 3-tert-butylpyridine;3-tert-butylthiophene.
What is the SMILES notation for 3-tert-butylpyridine;3-tert-butylthiophene?
The canonical SMILES for 3-tert-butylpyridine;3-tert-butylthiophene is CC(C)(C)c1cccnc1.CC(C)(C)c1ccsc1.
What is the InChIKey of 3-tert-butylpyridine;3-tert-butylthiophene?
The InChIKey is MWEOELZFOZMRTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N.C8H12S/c1-9(2,3)8-5-4-6-10-7-8;1-8(2,3)7-4-5-9-6-7/h4-7H,1-3H3;4-6H,1-3H3.
What are the key properties of 3-tert-butylpyridine;3-tert-butylthiophene?
3-tert-butylpyridine;3-tert-butylthiophene has a molecular weight of 275.46 g/mol, XLogP of 5.42, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butylpyridine;3-tert-butylthiophene is sourced from PubChem (CID 159689171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).