C25H24N4O3 — CID 159689502
17-(7-aminoheptyl)-6-nitro-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(20),2,4(9),5,7,12,14,16,18-nonaen-11-one (PubChem CID 159689502) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is 17-(7-aminoheptyl)-6-nitro-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(20),2,4(9),5,7,12,14,16,18-nonaen-11-one.
| Compound Name | 17-(7-aminoheptyl)-6-nitro-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(20),2,4(9),5,7,12,14,16,18-nonaen-11-one |
|---|---|
| PubChem CID | 159689502 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 17-(7-aminoheptyl)-6-nitro-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(20),2,4(9),5,7,12,14,16,18-nonaen-11-one |
| SMILES | NCCCCCCCc1ccc2c3c1cccc3c(=O)n1c3ccc([N+](=O)[O-])cc3nc21 |
| InChI | InChI=1S/C25H24N4O3/c26-14-5-3-1-2-4-7-16-10-12-19-23-18(16)8-6-9-20(23)25(30)28-22-13-11-17(29(31)32)15-21(22)27-24(19)28/h6,8-13,15H,1-5,7,14,26H2 |
| InChIKey | SFTWWZCVDFEVLL-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|