C13H16N6O4S — CID 159689531
2,3-dihydro-1H-benzimidazol-5-amine;molecular hydrogen;5-nitro-1,3-dihydro-2λ6,1,3-benzothiadiazole 2,2-dioxide (PubChem CID 159689531) has the molecular formula C13H16N6O4S and a molecular weight of 352.38 g/mol. Its IUPAC name is 2,3-dihydro-1H-benzimidazol-5-amine;molecular hydrogen;5-nitro-1,3-dihydro-2λ6,1,3-benzothiadiazole 2,2-dioxide.
| Compound Name | 2,3-dihydro-1H-benzimidazol-5-amine;molecular hydrogen;5-nitro-1,3-dihydro-2λ6,1,3-benzothiadiazole 2,2-dioxide |
|---|---|
| PubChem CID | 159689531 |
| Molecular Formula | C13H16N6O4S |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 2,3-dihydro-1H-benzimidazol-5-amine;molecular hydrogen;5-nitro-1,3-dihydro-2λ6,1,3-benzothiadiazole 2,2-dioxide |
| SMILES | Nc1ccc2c(c1)NCN2.O=[N+]([O-])c1ccc2c(c1)NS(=O)(=O)N2.[H][H] |
| InChI | InChI=1S/C7H9N3.C6H5N3O4S.H2/c8-5-1-2-6-7(3-5)10-4-9-6;10-9(11)4-1-2-5-6(3-4)8-14(12,13)7-5;/h1-3,9-10H,4,8H2;1-3,7-8H;1H |
| InChIKey | MWFQKRMIZDICDB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_E(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|