C32H18Cl5FN4 — CID 159692059
2-chloro-6-[(2,6-dichlorophenyl)-isocyanomethyl]pyridine;2-[(2,6-dichlorophenyl)-isocyanomethyl]-6-(4-fluorophenyl)pyridine (PubChem CID 159692059) has the molecular formula C32H18Cl5FN4 and a molecular weight of 654.79 g/mol. Its IUPAC name is 2-chloro-6-[(2,6-dichlorophenyl)-isocyanomethyl]pyridine;2-[(2,6-dichlorophenyl)-isocyanomethyl]-6-(4-fluorophenyl)pyridine.
| Compound Name | 2-chloro-6-[(2,6-dichlorophenyl)-isocyanomethyl]pyridine;2-[(2,6-dichlorophenyl)-isocyanomethyl]-6-(4-fluorophenyl)pyridine |
|---|---|
| PubChem CID | 159692059 |
| Molecular Formula | C32H18Cl5FN4 |
| Molecular Weight | 654.79 g/mol |
| Exact Mass | 652.00 |
| IUPAC Name | 2-chloro-6-[(2,6-dichlorophenyl)-isocyanomethyl]pyridine;2-[(2,6-dichlorophenyl)-isocyanomethyl]-6-(4-fluorophenyl)pyridine |
| SMILES | [C-]#[N+]C(c1cccc(-c2ccc(F)cc2)n1)c1c(Cl)cccc1Cl.[C-]#[N+]C(c1cccc(Cl)n1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C19H11Cl2FN2.C13H7Cl3N2/c1-23-19(18-14(20)4-2-5-15(18)21)17-7-3-6-16(24-17)12-8-10-13(22)11-9-12;1-17-13(10-6-3-7-11(16)18-10)12-8(14)4-2-5-9(12)15/h2-11,19H;2-7,13H |
| InChIKey | MWNSWGPILZFAKF-UHFFFAOYSA-N |
| XLogP | 11.25 |
| TPSA | 34.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.79 |
| LogP ≤ 5 | 11.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|