About 2,2-dicyclohexylethanamine;dicyclohexylmethanamine;(4-phenylphenyl)methanamine
2,2-dicyclohexylethanamine;dicyclohexylmethanamine;(4-phenylphenyl)methanamine (PubChem CID 159692135) has the molecular formula C40H65N3
and a molecular weight of 587.98 g/mol. Its IUPAC name is 2,2-dicyclohexylethanamine;dicyclohexylmethanamine;(4-phenylphenyl)methanamine.
Molecular Properties
| Compound Name | 2,2-dicyclohexylethanamine;dicyclohexylmethanamine;(4-phenylphenyl)methanamine |
| PubChem CID | 159692135 |
| Molecular Formula | C40H65N3 |
| Molecular Weight | 587.98 g/mol |
| Exact Mass | 587.52 |
| IUPAC Name | 2,2-dicyclohexylethanamine;dicyclohexylmethanamine;(4-phenylphenyl)methanamine |
| SMILES | NC(C1CCCCC1)C1CCCCC1.NCC(C1CCCCC1)C1CCCCC1.NCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C14H27N.C13H25N.C13H13N/c15-11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13;14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h12-14H,1-11,15H2;11-13H,1-10,14H2;1-9H,10,14H2 |
| InChIKey | MWNZNDJLEKYGOC-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 587.98 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-dicyclohexylethanamine;dicyclohexylmethanamine;(4-phenylphenyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dicyclohexylethanamine;dicyclohexylmethanamine;(4-phenylphenyl)methanamine?
The IUPAC name of 2,2-dicyclohexylethanamine;dicyclohexylmethanamine;(4-phenylphenyl)methanamine (CID 159692135) is 2,2-dicyclohexylethanamine;dicyclohexylmethanamine;(4-phenylphenyl)methanamine.
What is the SMILES notation for 2,2-dicyclohexylethanamine;dicyclohexylmethanamine;(4-phenylphenyl)methanamine?
The canonical SMILES for 2,2-dicyclohexylethanamine;dicyclohexylmethanamine;(4-phenylphenyl)methanamine is NC(C1CCCCC1)C1CCCCC1.NCC(C1CCCCC1)C1CCCCC1.NCc1ccc(-c2ccccc2)cc1.
What is the InChIKey of 2,2-dicyclohexylethanamine;dicyclohexylmethanamine;(4-phenylphenyl)methanamine?
The InChIKey is MWNZNDJLEKYGOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N.C13H25N.C13H13N/c15-11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13;14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h12-14H,1-11,15H2;11-13H,1-10,14H2;1-9H,10,14H2.
What are the key properties of 2,2-dicyclohexylethanamine;dicyclohexylmethanamine;(4-phenylphenyl)methanamine?
2,2-dicyclohexylethanamine;dicyclohexylmethanamine;(4-phenylphenyl)methanamine has a molecular weight of 587.98 g/mol, XLogP of 10.01, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dicyclohexylethanamine;dicyclohexylmethanamine;(4-phenylphenyl)methanamine is sourced from PubChem (CID 159692135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).