About 4-chloro-1-methyl-3a,7a-dihydroimidazo[4,5-c]pyridine
4-chloro-1-methyl-3a,7a-dihydroimidazo[4,5-c]pyridine (PubChem CID 159692170) has the molecular formula C7H8ClN3
and a molecular weight of 169.61 g/mol. Its IUPAC name is 4-chloro-1-methyl-3a,7a-dihydroimidazo[4,5-c]pyridine.
Molecular Properties
| Compound Name | 4-chloro-1-methyl-3a,7a-dihydroimidazo[4,5-c]pyridine |
| PubChem CID | 159692170 |
| Molecular Formula | C7H8ClN3 |
| Molecular Weight | 169.61 g/mol |
| Exact Mass | 169.04 |
| IUPAC Name | 4-chloro-1-methyl-3a,7a-dihydroimidazo[4,5-c]pyridine |
| SMILES | CN1C=NC2C(Cl)=NC=CC21 |
| InChI | InChI=1S/C7H8ClN3/c1-11-4-10-6-5(11)2-3-9-7(6)8/h2-6H,1H3 |
| InChIKey | MWOBJNYWFODSLT-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.61 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-1-methyl-3a,7a-dihydroimidazo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1-methyl-3a,7a-dihydroimidazo[4,5-c]pyridine?
The IUPAC name of 4-chloro-1-methyl-3a,7a-dihydroimidazo[4,5-c]pyridine (CID 159692170) is 4-chloro-1-methyl-3a,7a-dihydroimidazo[4,5-c]pyridine.
What is the SMILES notation for 4-chloro-1-methyl-3a,7a-dihydroimidazo[4,5-c]pyridine?
The canonical SMILES for 4-chloro-1-methyl-3a,7a-dihydroimidazo[4,5-c]pyridine is CN1C=NC2C(Cl)=NC=CC21.
What is the InChIKey of 4-chloro-1-methyl-3a,7a-dihydroimidazo[4,5-c]pyridine?
The InChIKey is MWOBJNYWFODSLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8ClN3/c1-11-4-10-6-5(11)2-3-9-7(6)8/h2-6H,1H3.
What are the key properties of 4-chloro-1-methyl-3a,7a-dihydroimidazo[4,5-c]pyridine?
4-chloro-1-methyl-3a,7a-dihydroimidazo[4,5-c]pyridine has a molecular weight of 169.61 g/mol, XLogP of 0.86, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1-methyl-3a,7a-dihydroimidazo[4,5-c]pyridine is sourced from PubChem (CID 159692170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).