About 4-[2-(4-cyanoanilino)-5-(furan-3-yl)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile
4-[2-(4-cyanoanilino)-5-(furan-3-yl)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile (PubChem CID 159694045) has the molecular formula C24H17N5O2
and a molecular weight of 407.43 g/mol. Its IUPAC name is 4-[2-(4-cyanoanilino)-5-(furan-3-yl)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile.
Molecular Properties
| Compound Name | 4-[2-(4-cyanoanilino)-5-(furan-3-yl)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile |
| PubChem CID | 159694045 |
| Molecular Formula | C24H17N5O2 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 4-[2-(4-cyanoanilino)-5-(furan-3-yl)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile |
| SMILES | Cc1cc(C#N)cc(C)c1Oc1nc(Nc2ccc(C#N)cc2)ncc1-c1ccoc1 |
| InChI | InChI=1S/C24H17N5O2/c1-15-9-18(12-26)10-16(2)22(15)31-23-21(19-7-8-30-14-19)13-27-24(29-23)28-20-5-3-17(11-25)4-6-20/h3-10,13-14H,1-2H3,(H,27,28,29) |
| InChIKey | MWTWCXFFMUSVFS-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 107.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[2-(4-cyanoanilino)-5-(furan-3-yl)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(4-cyanoanilino)-5-(furan-3-yl)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile?
The IUPAC name of 4-[2-(4-cyanoanilino)-5-(furan-3-yl)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile (CID 159694045) is 4-[2-(4-cyanoanilino)-5-(furan-3-yl)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile.
What is the SMILES notation for 4-[2-(4-cyanoanilino)-5-(furan-3-yl)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile?
The canonical SMILES for 4-[2-(4-cyanoanilino)-5-(furan-3-yl)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile is Cc1cc(C#N)cc(C)c1Oc1nc(Nc2ccc(C#N)cc2)ncc1-c1ccoc1.
What is the InChIKey of 4-[2-(4-cyanoanilino)-5-(furan-3-yl)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile?
The InChIKey is MWTWCXFFMUSVFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17N5O2/c1-15-9-18(12-26)10-16(2)22(15)31-23-21(19-7-8-30-14-19)13-27-24(29-23)28-20-5-3-17(11-25)4-6-20/h3-10,13-14H,1-2H3,(H,27,28,29).
What are the key properties of 4-[2-(4-cyanoanilino)-5-(furan-3-yl)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile?
4-[2-(4-cyanoanilino)-5-(furan-3-yl)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile has a molecular weight of 407.43 g/mol, XLogP of 5.63, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(4-cyanoanilino)-5-(furan-3-yl)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile is sourced from PubChem (CID 159694045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).